Reacción #470394

ord-a3a8d3c2613447acba254d6162d7c5c4

Ecuación de reacción

CC(C)c1cccc(C(C)C)c1Nc1ccccc1N
N1-(2,6-diisopropylphenyl)benzene-1,2-diamine
CC(C)c1cccc(C(C)C)c1-n1c(-c2ccccc2)nc2ccccc21
desired product
Rendimiento 59.9%
CC(C)c1cccc(C(C)C)c1-n1c(-c2ccccc2)nc2ccccc21
1-(2,6-diisopropylphenyl)-2-phenyl-1H-benzo[d]imidazole
Rendimiento 59.9%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Temperaturaunder reflux for 3 hours
  2. 2
    TemperaturaThe reaction mixture was heated up again
  3. 3
    Temperaturato reflux overnight
  4. 4
    OtroAir was bubbled through the reaction
  5. 5
    Temperaturawhile reflux
  6. 6
    OtroThe solvent was evaporated
  7. 7
    workup.DISSOLUTIONThe residue was dissolved in dichloromethane (200 mL)
  8. 8
    OtroThe crude product was purified by column chromatography

Procedimiento

N1-(2,6-diisopropylphenyl)benzene-1,2-diamine (8.5 g, 32 mmol) and benzldehyde (3 g, 28.8 mmol) were reacted in acetonitrile (100 ml) under reflux for 3 hours. The reaction mixture was cooled to room temperature. Ferric chloride (0.05 g, 0.28 mmol) was added. The reaction mixture was heated up again to reflux overnight. Air was bubbled through the reaction while reflux. The solvent was evaporated. The residue was dissolved in dichloromethane (200 mL) and ran through a short silica gel plug. The crude product was purified by column chromatography using dichloromethane to 3% of ethyl acetate in dichloromethane. 3.4 g of desired product was obtained.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08367223B2uspto-grants-2013_02