Reacción #442870

ord-5218ae225c5a4eb7bb97a93121168c76

Ecuación de reacción

CCOC(=O)CBr
ethyl bromoacetate
CCOC(=O)c1cc2cccc([N+](=O)[O-])c2[nH]1
ethyl 7-nitro-1H-indole-2-carboxylate
[H-].[Na+]
sodium hydride
CCOC(=O)Cn1c(C(=O)OCC)cc2cccc([N+](=O)[O-])c21
ethyl 1-ethoxycarbonylmethyl-7-nitro-1H-indole-2-carboxylate
Rendimiento 78.0%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    workup.STIRRINGthe resulting mixture was stirred at 50°-60° C. for 4 hours
  2. 2
    TemperaturaThe reaction mixture was cooled to room temperature
  3. 3
    Extracciónfollowed by extraction with ethyl acetate (three times)
  4. 4
    LavadoThe organic layer was washed with water
  5. 5
    Secadodried over anhydrous magnesium sulfate
  6. 6
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  7. 7
    Otrothe resulting residue was purified by a silica gel column chromatography (eluent: ethyl acetate/n-hexane=5/95)

Procedimiento

To a solution of ethyl 7-nitro-1H-indole-2-carboxylate (2.00 g, 8.45 mmol) in N,N-dimethylformamide (50 ml) was added 60% sodium hydride (0.34 g, 8.54 mmol), and the reaction mixture was stirred at room temperature until it became transparent. Then, ethyl bromoacetate (1.43 g, 8.54 mmol) was added and the resulting mixture was stirred at 50°-60° C. for 4 hours. The reaction mixture was cooled to room temperature and poured into ice water, followed by extraction with ethyl acetate (three times). The organic layer was washed with water and dried over anhydrous magnesium sulfate. The solvent was distilled off under reduced pressure and the resulting residue was purified by a silica gel column chromatography (eluent: ethyl acetate/n-hexane=5/95) to obtain ethyl 1-ethoxycarbonylmethyl-7-nitro-1H-indole-2-carboxylate (2.11 g).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05834454uspto-grants-1998_11