Reacción #414483

ord-0586bc5fac30461e9e110e4918e5c447

Ecuación de reacción

B.[Na]
sodium boron hydride
Cl
hydrochloric acid
O=S([O-])O.[Na+]
sodium hydrogen sulfite
[Cl-].[Na+]
sodium chloride
[Na+].[O-][I+3]([O-])([O-])[O-]
sodium periodate
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(CO)=CC[C@H]12
geniposide
COC(=O)C1=CO[C@@H](O)[C@@H]2C(CO)=CC[C@H]12
genipin
Rendimiento 73.8%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    workup.STIRRINGthe reaction mixture was further stirred at room temperature for two hours
  2. 2
    workup.STIRRINGthe reaction mixture was stirred at room temperature for four hours
  3. 3
    workup.STIRRINGthe reaction mixture was stirred
  4. 4
    Otroto thereby separate an ether layer
  5. 5
    OtroAfter the ether layer was separated
  6. 6
    Otrodried
  7. 7
    workup.DISTILLATIONether was distilled off
  8. 8
    Otroa yellow solid was obtained
  9. 9
    OtroThe solid was further recrystallized from methanol and ether

Procedimiento

First, 100 g of geniposide was dissolved in 650 ml of water. After 115 g of sodium periodate was added to the solution, the reaction mixture was stirred at room temperature for two hours. After 41 g of sodium boron hydride was further added, the reaction mixture was further stirred at room temperature for two hours. Subsequently, a 6N aqueous hydrochloric acid solution and ether were added, the reaction mixture was stirred at room temperature for four hours After the addition of sodium hydrogen sulfite and sodium chloride, the reaction mixture was stirred to thereby separate an ether layer. After the ether layer was separated and dried, ether was distilled off, and a yellow solid was obtained. The solid was further recrystallized from methanol and ether to yield 43 g of genipin.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05272172uspto-grants-1993_12