Reacción #2467940

ord-c05d27514d6d42968b618997d8093e32

Ecuación de reacción

CCOC(=O)c1nc(-c2ccccc2)cs1
4-phenyl-thiazole-2-carboxylic acid ethyl ester
[K+].[OH-]
KOH
O=C(O)c1nc(-c2ccccc2)cs1
4-phenyl-thiazole-2carboxylic acid
Rendimiento 76.5%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otroto react at 60° C. for 15 minutes
  2. 2
    OtroAfter the solvent was evaporated from the reaction mixture
  3. 3
    workup.DISSOLUTIONthe residue was dissolved
  4. 4
    workup.ADDITIONby adding water
  5. 5
    OtroThe produced precipitates
  6. 6
    Filtraciónwere filtered with suction
  7. 7
    Lavadowashed with water
  8. 8
    Otrorecrystallized from methanol-water

Procedimiento

To a solution of 4-phenyl-thiazole-2-carboxylic acid ethyl ester (282 mg, 1.21 mmol) dissolved in methanol (10 ml) was added 1N—KOH (3.63 ml, 3.63 mmol) and the mixture was allowed to react at 60° C. for 15 minutes. After the solvent was evaporated from the reaction mixture, the residue was dissolved by adding water and acidified (pH=2) with 2N—HCl under ice cooling. The produced precipitates were filtered with suction, washed with water and recrystallized from methanol-water to afford 190 mg (yield 72%) of the desired 4-phenyl-thiazole-2carboxylic acid as white solids.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08257931B2uspto-grants-2012_09