Reacción #2146682

ord-60c71ee509b54dc29ebf2ba185f2e5c9

Ecuación de reacción

O=C(CBr)c1ccc(O)cc1
2-bromo-4′-hydroxyacetophenone
COc1ccc(N)nc1
2-amino-5-methoxypyridine
Br.COc1ccc2nc(-c3ccc(O)cc3)cn2c1
2-(4′-hydroxyphenyl)-6-methoxyimidazo[1,2-a]pyridine hydrobromide salt

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otroto react with each other at a reflux temperature for 2 to 6 hours

Procedimiento

First, 2-bromo-4′-hydroxyacetophenone and 2-amino-5-methoxypyridine are dissolved in an inactive solvent such as acetonitrile, and are allowed to react with each other at a reflux temperature for 2 to 6 hours to produce 2-(4′-hydroxyphenyl)-6-methoxyimidazo[1,2-a]pyridine hydrobromide salt as white precipitates. The inactive solvent used in this instance may be acetonitrile or another solvent that is usually employed in a similar reaction, for example, methanol and acetone. The reaction temperature may be a temperature allowing refluxing, for example, 90° C. when the solvent is acetonitrile. The amount of the solvent to be used may be an amount sufficient to effect the reaction, however, it should be noted that if the solvent is too much, it will become difficult to obtain precipitates of reaction products. For example, when 2-bromo-4′-hydroxyacetophenone in an amount corresponding to 10 mmol is used for the reaction, the amount of a solvent to be used can be about 40 to 50 mL.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08277777B2uspto-grants-2012_10