Reacción #2020

ord-f701c8034cd64527bb66e1cb9184c5a6

Ecuación de reacción

O=C(N[C@H](CCc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21
(R)-α-[N-(9-Fluorenylmethoxycarbonyl)amino]-benzenebutanoic acid
CNc1ccc(-c2ccccc2C#N)cc1
4-[N-methylamino]-2'-cyano-1,1'-biphenyl
O=C(Cl)C(=O)Cl
oxalyl chloride
CCN(CC)CC
Triethylamine
CN(C(=O)[C@H](N)CCc1ccccc1)c1ccc(-c2ccccc2C#N)cc1
(R)-α-[Amino]-N-methyl-N-[(2'-cyano)-[1,1'-biphenyl]-4-yl]benzenebutanamide

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otrowas obtained
  2. 2
    Otroused without further purification
  3. 3
    workup.STIRRINGthe reaction mixture stirred for a further 6 h
  4. 4
    OtroThe reaction was quenched with 4-(aminomethyl)-piperidine (0.5 ml)
  5. 5
    workup.STIRRINGstirred for 15 minutes
  6. 6
    Otropartitioned between water and methylene chloride
  7. 7
    OtroThe organic phase was separated
  8. 8
    Otrodried
  9. 9
    OtroThe volatiles were removed under reduced pressure
  10. 10
    Otrothe residues chromatographed on silica gel

Procedimiento

(R)-α-[N-(9-Fluorenylmethoxycarbonyl)amino]-benzenebutanoic acid (500 mg; 1.25 mmol), was converted into its corresponding acid chloride according to the procedure descibed in Example 33, Step F using 1 drop of DMF, oxalyl chloride (136 μl) in methylene chloride (2.5 ml). A yellow solid which was the acid chloride (525 mg) was obtained and used without further purification. A portion of the acid chloride (222.8 mg; 0.528 mmol) was added to 4-[N-methylamino]-2'-cyano-1,1'-biphenyl (110 mg; 0.528 mmol) were dissolved in methylene chloride (1 ml) and stirred together for 2 h at room temperature. Triethylamine (73.6 μl; 0.528 mmol) was added and the reaction mixture stirred for a further 6 h. The reaction was quenched with 4-(aminomethyl)-piperidine (0.5 ml) and stirred for 15 minutes and then partitioned between water and methylene chloride. The organic phase was separated, dried over powdered potassium carbonate. The volatiles were removed under reduced pressure and the residues chromatographed on silica gel using ethyl acetate and then ethyl acetate and methanol 9:1 v/v. The yield of the desired product was 60.2 mg (30.8%). FAB-MS:- calculated for C24H23N30 369.2 found 370.0 (M+1).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05726319uspto-grants-1998_03