Reacción #1962001

ord-a8f6ec24f800483090ffc2f5fa76827b

Ecuación de reacción

CCOC(=O)c1cc2cccc([N+](=O)[O-])c2[nH]1
ethyl 7-nitro-1H-indole-2-carboxylate
CCOC(=O)c1cc2cccc(N)c2[nH]1
title compound
CCOC(=O)c1cc2cccc(N)c2[nH]1
ethyl 7-amino-1H-indole-2-carboxylate

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroThe mixture was evacuated
  2. 2
    Otroflushed with nitrogen three times
  3. 3
    Otroflushed with hydrogen (60 psi)
  4. 4
    Otroevacuated three times
  5. 5
    workup.ADDITIONfilled with hydrogen (60 psi)
  6. 6
    Filtraciónthe reaction mixture was filtered through celite
  7. 7
    ConcentraciónThe filtrate was concentrated
  8. 8
    Otrothe residue was purified by column chromatography (hexane/EtOAc)

Procedimiento

Platinum(IV) oxide (0.024 g, 0.107 mmol) was added to a suspension of ethyl 7-nitro-1H-indole-2-carboxylate (0.10 g, 0.30 mmol) in ethanol (20 mL) in a Fisher-Porter vessel. The mixture was evacuated and flushed with nitrogen three times, flushed with hydrogen (60 psi) and evacuated three times, then filled with hydrogen (60 psi). After 30 min, the reaction mixture was filtered through celite. The filtrate was concentrated and the residue was purified by column chromatography (hexane/EtOAc) to give the title compound (0.324 g, 74%) as a yellow solid. 1H NMR (400 MHz, CDCl3): δ ppm 9.60 (s, 1H), 7.22 (d, 1H), 7.19 (d, 1H), 6.94-7.03 (m, 1H), 6.66 (d, 1H), 4.43 (q, 2H), 1.44 (t, 3H). MS: m/z 205 (M+1).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08304419B2uspto-grants-2012_11