Reacción #1904031

ord-1e533ec7d6d54ba6aa9d14a3e049983c

Ecuación de reacción

[H][H]
hydrogen
[N-]=[N+]=NCCC(CCN=[N+]=[N-])CCN=[N+]=[N-]
Tris(2-azidoethyl)methane
NCCC(CCN)CCN
tris(2-aminoethyl)methane
Rendimiento 100.0%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroThe reaction vessel was evacuated every 2 hours
  2. 2
    Otroto remove nitrogen
  3. 3
    Otroevolved from the reaction
  4. 4
    workup.DISTILLATIONCaution: unreduced azide could explode on distillation
  5. 5
    FiltraciónThe reaction was filtered through a celite pad
  6. 6
    Otroto remove the catalyst
  7. 7
    Concentraciónconcentrated in vacuo

Procedimiento

Tris(2-azidoethyl)methane (15.06 g, 0.0676 mol), (assuming 100% yield from previous reaction) in ethanol (200 ml) was treated with 10% palladium on charcoal (2 g, 50% water) and hydrogenated for 12 h. The reaction vessel was evacuated every 2 hours to remove nitrogen evolved from the reaction and refilled with hydrogen. A sample was taken for NMR analysis to confirm complete conversion of the triazide to the triamine. Caution: unreduced azide could explode on distillation. The reaction was filtered through a celite pad to remove the catalyst and concentrated in vacuo to give tris(2-aminoethyl)methane as an oil. This was further purified by Kugelrohr distillation bp.180-200° C. at 0.4 mm/Hg to give a colourless oil (8.1 g, 82.7% overall yield from the triol).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US07597875B2uspto-grants-2009_10