Reacción #1702096

ord-f3453c449dbe4886a96a657d349ed864

Ecuación de reacción

CCOP(C)(=O)CCNc1cc(C#CC(C)(C)C)sc1C(=O)OC
5-(3,3-Dimethyl-but-1-ynyl)-3-[2-(ethoxy-methyl-phosphinoyl)-ethylamino]-thiophene-2-carboxylic acid methyl ester
CC1CCC(C(=O)Cl)CC1
4-methyl-cyclohexanecarbonyl chloride
CCOP(C)(=O)CCN(C(=O)C1CCC(C)CC1)c1cc(C#CC(C)(C)C)sc1C(=O)OC
5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid methyl ester
Rendimiento 80.5%

Disolventes

Condiciones de reacción

Temperatura
100°CELSIUS
Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Temperaturathe heat to the oil bath
  2. 2
    workup.STIRRINGto stir for a further 9 hours
  3. 3
    Extracciónextracted with H2O
  4. 4
    ExtracciónThe organic phase was then extracted with brine
  5. 5
    Secadodried over Na2SO4
  6. 6
    OtroThe drying agent was removed by vacuum filtration
  7. 7
    Concentraciónthe filtrate was concentrated

Procedimiento

5-(3,3-Dimethyl-but-1-ynyl)-3-[2-(ethoxy-methyl-phosphinoyl)-ethylamino]-thiophene-2-carboxylic acid methyl ester (233 mg, 0.629 mmol) was dissolved in pyridine (4 mL) and then 4-methyl-cyclohexanecarbonyl chloride (506 mg, 3.15 mmol) was added. The reaction was stirred for 7 hours at 100° C., the heat to the oil bath was shut off and the reaction was allowed to stir for a further 9 hours. The reaction was diluted with EtOAc and extracted with H2O. The organic phase was then extracted with brine and dried over Na2SO4. The drying agent was removed by vacuum filtration and the filtrate was concentrated. 5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid methyl ester (251 mg, 78%) was isolated from the residue by silica gel column chromatography.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08765722B2uspto-grants-2014_07