Reacción #160837

ord-567ac49590a44c5288b0f8201afa293a

Ecuación de reacción

O=C(Cl)C(Cl)(Cl)Cl
Trichloracetyl chloride
[Al+3].[Cl-].[Cl-].[Cl-]
aluminum trichloride
N#Cc1ccc[nH]1
2-cyanopyrrole
N#Cc1cc(C(=O)C(Cl)(Cl)Cl)c[nH]1
desired product
Rendimiento 100.8%
N#Cc1cc(C(=O)C(Cl)(Cl)Cl)c[nH]1
4-(trichloroacetyl)-1H-pyrrole-2-carbonitrile
Rendimiento 100.8%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    TemperaturaThe reaction was heated
  2. 2
    Temperaturaat reflux for 5 h
  3. 3
    Temperaturato cool
  4. 4
    Otroquenched slowly with water (300 mL)
  5. 5
    OtroThe layers were separated
  6. 6
    Lavadothe organic layer was washed with water and brine
  7. 7
    Secadodried (magensium sulfate)
  8. 8
    Otroevaporated under reduced pressure

Procedimiento

Trichloracetyl chloride (44.4 g, 27.3 mL, 244 mmol) in dichloromethane (75 mL) was added over 20 min to a mechanically stirred suspension of aluminum trichloride (54.3 g, 407 mmol) in dichloromethane (150 mL). The resulting mixture was stirred for 30 min, and then 2-cyanopyrrole (15.0 g, 163 mmol) in dichloromethane (75 mL) was added over 30 min. The reaction was heated at reflux for 5 h and then allowed to cool. The reaction was diluted with ethyl acetate (600 mL) and then quenched slowly with water (300 mL). The layers were separated and then the organic layer was washed with water and brine, dried (magensium sulfate) and evaporated under reduced pressure to afford a quantitative yield of desired product (39.0 g, 100%) containing trace impurities. This material was used in the next step without further purification. 1H NMR (DMSO-d6) δ 8.14 (s, 1H), 7.55 (s, 1H).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08829185B2uspto-grants-2014_09