Reacción #1605841

ord-507af16bc76c47af83f364881c841c8b

Ecuación de reacción

O=C(Cl)N(Cc1ccccc1)Cc1ccccc1
dibenzylcarbamoyl chloride
O=c1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2[nH]1
dehydro-aripiprazole
O=C(Oc1ccc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2n1)N(Cc1ccccc1)Cc1ccccc1
7-(4-(4-(2,3-dichlorophenyl)piperazin-1-yl)butoxy)quinolin-2-yl dibenzylcarbamate

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Temperaturathe reaction mixture heated
  2. 2
    Temperaturaat reflux for 4 h
  3. 3
    ConcentraciónThe reaction mixture was concentrated
  4. 4
    workup.DISSOLUTIONThe residue was dissolved in ethyl acetate (ethyl acetate)
  5. 5
    Lavadowashed with water
  6. 6
    Secadodried over MgSO4
  7. 7
    OtroAfter evaporation the residue
  8. 8
    Otrowas further purified on silica eluting with ethyl acetate
  9. 9
    Otroafter drying
  10. 10
    Otrogave Compound-342 (0.71 g) as a white solid

Procedimiento

To a solution of dibenzylcarbamoyl chloride (1.7 g, 6.7 mmol) in pyridine (15 mL) was added dehydro-aripiprazole (1.5 g, 3.4 mmol) and the reaction mixture heated at reflux for 4 h. The reaction mixture was concentrated and the residue co-evaporated with toluene (×3). The residue was dissolved in ethyl acetate (ethyl acetate), washed with water and dried over MgSO4. After evaporation the residue was further purified on silica eluting with ethyl acetate and after drying gave Compound-342 (0.71 g) as a white solid.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US09072788B2uspto-grants-2015_07