Reacción #155381

ord-0a286e3ff5b548f5ad46e9563e234492

Ecuación de reacción

CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccc(CCl)cc1
chloromethyl alkoxyamine
CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccc(CCl)cc1
N-tert-Butyl-O-[1-(4-chloromethyl-phenyl)-ethyl]-N-(2-methyl-1-phenyl-propyl)-hydroxylamine
[I-].[Na+]
sodium iodide
CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccc(CI)cc1
iodomethyl
CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccc(CI)cc1
N-tert-Butyl-O-[1-(4-iodomethyl-phenyl)-ethyl]-N-(2-methyl-1-phenyl-propyl)-hydroxylamine

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    OtroTo a 50-mL round-bottom flask equipped with a magnetic stirbar
  2. 2
    Otrothe reaction mixture was capped with a rubber septum
  3. 3
    OtroThe sodium chloride side product was remove by gravity filtration
  4. 4
    Concentraciónthe filtrate was concentrated on a rotary evaporator
  5. 5
    OtroThe crude oily product was purified by flash chromatography
  6. 6
    Lavadoeluting with hexanes

Procedimiento

To a 50-mL round-bottom flask equipped with a magnetic stirbar was added chloromethyl alkoxyamine 3 (1.789 g, 4.784 mmol) and acetone (20 mL). To the resulting solution was added sodium iodide (2.869 g, 19.14 mmol, 4 equiv) and the reaction mixture was capped with a rubber septum and allowed to stir for 24 hours at room temperature. The sodium chloride side product was remove by gravity filtration, and the filtrate was concentrated on a rotary evaporator. The crude oily product was purified by flash chromatography, eluting with hexanes. The desired iodomethyl akoxyamine 4 was obtained as a colorless oil (1.968 g, 88.3% yield). ESI-MS: m/z=466.0, observed; 465.41, calculated. 1H NMR (500 MHz, CDCl3, both diastereomers) δ 7.5-7.1 (m, 18H), 5.35 (t, 2H) 4.90 (q+q, 2H, both diastereomers), 4.55 (s, 4H), 3.55 (m, 2H), 3.40 (d, 1H, minor diastereomer), 3.30 (d, 1H, major diastereomer), 2.40 (m, 2H, both diastereomer), 2.30 (d, 2H), 1.65 (d, 3H, minor diastereomer), 1.58 (d, 3H, major diastereomer), 1.33 (d, 3H, minor diastereomer), 1.05 (s, 9H, major diastereomer), 0.98 (s, 6H), 0.95 (d, 3H, major diastereomer), 0.89 (d, 12H), 0.85 (d, 6H), 0.82 (s, 9H, minor diastereomer), 0.68 (s, 2H), 0.59 (d, 3H, minor diastereomer), 0.28 (d, 3H, major diastereomer).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US08821922B2uspto-grants-2014_09