Reacción #1435722

ord-21d514042e5546869747ebff7e22a158

Ecuación de reacción

[H-].[K+]
potassium hydride
C[Si](C)(C)OCCCC1=CC=CC1
(3-trimethylsiloxy-propyl)-cyclopentadiene
C[Si](C)(C)OCCC[c-]1cccc1.[K+]
potassium (3-trimethylsiloxypropyl)-cyclopentadienide
Rendimiento 70.0%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    workup.ADDITIONis added
  2. 2
    TemperaturaThe reaction is maintained
  3. 3
    ConcentraciónSubsequently, the resulting suspension is concentrated to dryness
  4. 4
    Otroleaving an oily solid that, when it
  5. 5
    Lavadois washed with hexane
  6. 6
    Otrogives a cream-coloured solid

Procedimiento

To a suspension of 0.4 g (10 mmol) of potassium hydride in tetrahydrofurane, 1.96 g (10 mmol) of a (3-trimethylsiloxy-propyl)-cyclopentadiene in tetrahydrofurane is added. The reaction is maintained under stirring for 2 hours. Subsequently, the resulting suspension is concentrated to dryness, leaving an oily solid that, when it is washed with hexane, gives a cream-coloured solid. (1.6 g, 7 mmol. Yield:70%).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US07211538B2uspto-grants-2007_05