Reacción #1379683

ord-4c37146b34604d178e2caab61e37c4b5

Ecuación de reacción

O
Water
CCn1ncc(C(=O)c2ccc3c(c2C)C(OC)CCS3(=O)=O)c1O
4-Methoxy-5-methyl-6-(1-ethyl-5-hydroxypyrazol-4-yl) carbonylthiochroman-1,1-dioxide
BrCc1ccccc1
benzyl bromide
O=C([O-])[O-].[K+].[K+]
potassium carbonate
CCn1ncc(C(=O)c2ccc3c(c2C)C(OC)CCS3(=O)=O)c1OCc1ccccc1
4-methoxy-5-methyl-6-(5-benzyloxy-1-ethylpyrazol-4-yl) carbonylthiochroman-1,1-dioxide
Rendimiento 74.0%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Temperaturaunder heat for 3 hours
  2. 2
    Extracciónthe reaction mixture was extracted with ethyl acetate
  3. 3
    OtroIts organic layer was separated
  4. 4
    Secadodried over anhydrous sodium sulfate
  5. 5
    workup.DISTILLATIONThen, the solvent was distilled off under reduced pressure
  6. 6
    Otrothe resultant oil was purified
  7. 7
    Otrowith flush column chromatography (Wako Gel C-300: hexane/ethyl acetate=2:3)

Procedimiento

4-Methoxy-5-methyl-6-(1-ethyl-5-hydroxypyrazol-4-yl) carbonylthiochroman-1,1-dioxide was used as a starting material (XIH). And, 0.4 g (1.10 mmol) thereof was dissolved in 5 ml of acetone, and 0.21 g (1.21 mmol) of benzyl bromide as a reaction reagent (XII) and 0.15 g (1.10 mmol) of potassium carbonate as a base were added. The resultant mixture was refluxed under heat for 3 hours. Water was added to the reaction mixture, and the reaction mixture was extracted with ethyl acetate. Its organic layer was separated, and dried over anhydrous sodium sulfate. Then, the solvent was distilled off under reduced pressure, and the resultant oil was purified with flush column chromatography (Wako Gel C-300: hexane/ethyl acetate=2:3) to give 0.37 g (yield 74%) of 4-methoxy-5-methyl-6-(5-benzyloxy-1-ethylpyrazol-4-yl) carbonylthiochroman-1,1-dioxide (Compound No. 62) as an end compound which comes under the general formula (XI). Table 21 shows the structures of the starting material (XIH) and the reaction reagent (XII), and the structure and the yield of the end product (I).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05756759uspto-grants-1998_05