Reacción #1379681

ord-cd834146234c47918068e81eed72fd80

Ecuación de reacción

O=C([O-])[O-].[Na+].[Na+]
sodium carbonate
CCn1ncc(C(=O)c2ccc3c(c2C)C(OC)CCS3(=O)=O)c1O
4-Methoxy-5-methyl-6-(1-ethyl-5-hydroxypyrazol-4-yl) carbonylthiochroman-1,1-dioxide
CCN(CC)CC
triethylamine
CC(=O)Cl
acetyl chloride
CCn1ncc(C(=O)c2ccc3c(c2C)C(OC)CCS3(=O)=O)c1OC(C)=O
4-methoxy-5-methyl-6-(1-ethyl-5-acetoxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide
Rendimiento 73.0%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otroto react at room temperature for 8 hours
  2. 2
    Extracciónthe reaction mixture was extracted with ethyl acetate, and its organic layer
  3. 3
    Secadowas dried over anhydrous sodium sulfate
  4. 4
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  5. 5
    Otrothe resultant oil was purified
  6. 6
    Otrowith flush column chromatography (Wako Gel C-300: hexane/ethyl acetate=1:2)

Procedimiento

4-Methoxy-5-methyl-6-(1-ethyl-5-hydroxypyrazol-4-yl) carbonylthiochroman-1,1-dioxide was used as a starting material (XIH). And, 0.40 g (1.1 mmol) thereof was dissolved in 4 ml of methylene chloride, and 0.22 g (2.2 mmol) of triethylamine as a base and 0.17 g (2.2 mmol) of acetyl chloride as a reaction reagent (XII) were added. The resultant mixture was allowed to react at room temperature for 8 hours. A saturated sodium carbonate aqueous solution was added to the reaction mixture, the reaction mixture was extracted with ethyl acetate, and its organic layer was dried over anhydrous sodium sulfate. The solvent was distilled off under reduced pressure, and the resultant oil was purified with flush column chromatography (Wako Gel C-300: hexane/ethyl acetate=1:2) to give 0.33 g (yield 73%) of 4-methoxy-5-methyl-6-(1-ethyl-5-acetoxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide (Compound No. 51) as an end compound which comes under the general formula (XI). Table 18 shows the structures of the starting material (XIH) and the reaction reagent (XII), and the structure and the yield of the end product (XI).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05756759uspto-grants-1998_05