Reacción #1350602

ord-a61e8e7c81f44b41abe7caf881c508e5

Ecuación de reacción

CC(C)(C)OC(=O)CN1CCCC[C@H](NC(=O)OCc2ccccc2)C1=O
tert-Butyl (3S)-3-benzyloxycarbonylamino-2-oxoperhydroazepine-1-acetate
CC(C)(C)OC(=O)CN1CCCC[C@H](N)C1=O
tert-butyl (3S)-3-amino-2-oxoperhydroazepine-1-acetate
Rendimiento 79.7%

Disolventes

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otropurged with argon
  2. 2
    workup.ADDITION10% palladium or carbon (1.5 g) was added
  3. 3
    Otrothe flask evacuated
  4. 4
    workup.ADDITIONfilled with hydrogen from a balloon
  5. 5
    OtroThe reaction mixture was then purged with argon
  6. 6
    Filtraciónfiltered through diatomaceous earth
  7. 7
    OtroThe filtrate was evaporated

Procedimiento

tert-Butyl (3S)-3-benzyloxycarbonylamino-2-oxoperhydroazepine-1-acetate (15 g) was disolved in ethanol (150 ml) and purged with argon. 10% palladium or carbon (1.5 g) was added and the flask evacuated and filled with hydrogen from a balloon. The reaction mixture was stirred at ambient temperature for 4 hours. The reaction mixture was then purged with argon and filtered through diatomaceous earth. The filtrate was evaporated to give tert-butyl (3S)-3-amino-2-oxoperhydroazepine-1-acetate (7.7 g) as a viscous oil; NMR (CDCl3): 1.45 (s, 9H), 1.55-2.05 (m, 6H), 3.2-3.3 (d, 1H), 3.55-3.75 (two overlapping doublets, 2H), 3.95-4.25 (q, 2H); mass spectroscopy, m/e (ES+) 243.2 (MH+).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US06541453B2uspto-grants-2003_04