Reacción #1165

ord-b437e05b173c435b946ece88305eb18d

Ecuación de reacción

CCS(=O)(=O)Cl
ethanesulfonyl chloride
O=C([O-])[O-].[K+].[K+]
potassium carbonate
CCn1ncc(C(=O)c2cc(C)c3c(c2C)C(C)(C)CCS3(=O)=O)c1O
4,4,5,8-tetramethyl-6-(1-ethyl-5-hydroxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide
c1cn[nH]c1
pyrazole
CCn1ncc(C(=O)c2cc(C)c3c(c2C)C(C)(C)CCS3(=O)=O)c1OS(=O)(=O)CC
4,4,5,8-tetramethyl-6-(1-ethyl-5-ethanesulfonyloxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide
Rendimiento 82.0%

Condiciones de reacción

Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    Otroto react at room temperature for 2 hours
  2. 2
    Temperaturafurther refluxed
  3. 3
    Temperaturaunder heat for 2 hours
  4. 4
    Temperaturato cool
  5. 5
    Otroa methylene chloride layer was recovered
  6. 6
    Secadodried over anhydrous sodium sulfate
  7. 7
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  8. 8
    Otrothe resultant oil was purified by silica gel column chromatography

Procedimiento

0.7 Gram (1.9 mmol) of the 4,4,5,8-tetramethyl-6-(1-ethyl-5-hydroxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide (Compound Ic-1) corresponding to pyrazole derivative (I-H), obtained in Referential Production Example 5, was dissolved in 8 ml of methylene chloride. Then, a solution of 0.51 g (3.8 mmol) of potassium carbonate in 5 ml of water was added, and further, 0.49 g (3.8 mmol) of ethanesulfonyl chloride and 0.05 g (0.2 mmol) of benzyltriethylammonium chloride, corresponding to compound B-A-Hal, were added. The mixture was allowed to react at room temperature for 2 hours, and further refluxed under heat for 2 hours. The reaction mixture was allowed to cool, and then a methylene chloride layer was recovered and dried over anhydrous sodium sulfate. The solvent was distilled off under reduced pressure, and the resultant oil was purified by silica gel column chromatography to give 0.73 g (yield 82%) of 4,4,5,8-tetramethyl-6-(1-ethyl-5-ethanesulfonyloxypyrazol-4-yl)carbonylthiochroman-1,1-dioxide (Compound Ic-2).

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US05723408uspto-grants-1998_03