Reacción #1135815

ord-c0079cdedc444569b26230c9ea02b7aa

Ecuación de reacción

Cl
hydrochloric acid
[N-]=[N+]=[N-].[Na+]
sodium azide
[Al+3].[Cl-].[Cl-].[Cl-]
aluminum chloride
O=N[O-].[Na+]
sodium nitrite
CCOc1cccc(N=C=O)c1C
1-ethoxy-3-isocyanato-2-methylbenzene
CCOc1cccc(-n2nn[nH]c2=O)c1C
1-(2-methyl-3-ethoxyphenyl)-1,4-dihydrotetrazole-5-one

Condiciones de reacción

Temperatura
75°CELSIUS
Condiciones detalladas
See reaction.notes.procedure_details.

Tratamiento posterior

  1. 1
    workup.STIRRINGwere stirred for five hours
  2. 2
    TemperaturaThe mixtures were cooled and under ice-
  3. 3
    Temperaturacooling, to the reaction mixtures
  4. 4
    ExtracciónThe mixtures were extracted with ethyl acetate
  5. 5
    Lavadothe organic layers were washed with water and saturated saline
  6. 6
    Secadowere dried over anhydrous magnesium sulfate
  7. 7
    Concentraciónwere then concentrated under reduced pressure

Procedimiento

Under ice-cooling, to a mixture of N,N-dimethylformamide 350 mL and anhydrous aluminum chloride 33.6 g was added sodium azide 15 g, and the resulting mixtures were stirred for one hour. Thereto was thereafter added 1-ethoxy-3-isocyanato-2-methylbenzene described in Reference Preparation example 2737.2 g and the resulting mixtures were heated to 75° C. and were stirred for five hours. The mixtures were cooled and under ice-cooling, to the reaction mixtures was added ice water 100 mL, followed by addition of a mixture of sodium nitrite 23 g and water 150 mL, and the mixtures were acidified with concentrated hydrochloric acid to pH about 4. The mixtures were extracted with ethyl acetate and the organic layers were washed with water and saturated saline, and were dried over anhydrous magnesium sulfate and were then concentrated under reduced pressure. The resulting residues were subjected to a silica gel column chromatography to give 1-(2-methyl-3-ethoxyphenyl)-1,4-dihydrotetrazole-5-one 39.0 g.

Fuente

DOI: 10.6084/m9.figshare.5104873.v1Patente: US09380782B2uspto-grants-2016_07