Reaction #939041

ord-72a186cea1e94986b168aa974f6763a2

Reaction equation

COC(=O)c1ccc(OCC(C)C)c([N+](=O)[O-])c1
Methyl 4-isobutyloxy-3-nitrobenzoate
[Na+].[OH-]
sodium hydroxide
CC(C)COc1ccc(C(=O)O)cc1[N+](=O)[O-]
desired compound
Yield 98.0%
CC(C)COc1ccc(C(=O)O)cc1[N+](=O)[O-]
4-Isobutyloxy-3-nitrobenzoic acid
Yield 98.0%

Solvents

Conditions

Detailed conditions
See reaction.notes.procedure_details.

Workup

  1. 1
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  2. 2
    workup.ADDITIONwere added to the residue water (20 mL) and 3M aqueous hydrochloric acid
  3. 3
    FiltrationThe precipitated crystalline product was collected by filtration
  4. 4
    WashThe crystalline product was washed with water (20 mL×2)
  5. 5
    Otherdried at 50° C. for 4 hours under reduced pressure

Procedure

Methyl 4-isobutyloxy-3-nitrobenzoate (2.50 g, 9.87 mmol) was dissolved in a mixture of methanol (10 mL) and 25 THF (10 mL). After addition of 2M aqueous sodium hydroxide (7.5 mL, 15.0 mmol), the solution was stirred for 18 hours at room temperature. The solvent was distilled off under reduced pressure, and were added to the residue water (20 mL) and 3M aqueous hydrochloric acid to adjust 30 the solution to pH 1. The precipitated crystalline product was collected by filtration. The crystalline product was washed with water (20 mL×2) and dried at 50° C. for 4 hours under reduced pressure, to give 2.31 g (yield 98%) of the desired compound in the form of a white crystalline product.

Source

DOI: 10.6084/m9.figshare.5104873.v1Patent: US07253154B2uspto-grants-2007_08