Reaction #487495

ord-162e26bc9b7841bfbac2c9821c07a847

Reaction equation

O=C(O)c1ccc([N+](=O)[O-])cc1
p-nitrobenzoic acid
O=S(Cl)Cl
thionyl chloride
O=C(Cl)c1ccc([N+](=O)[O-])cc1
4-nitrobenzoyl chloride
Yield 100.0%

Conditions

Detailed conditions
See reaction.notes.procedure_details.

Workup

  1. 1
    Temperatureis heated
  2. 2
    Temperatureto reflux for approximately 6-7 hours until a clear solution
  3. 3
    Otheris obtained
  4. 4
    OtherExcess of thionyl chloride is removed by distillation
  5. 5
    workup.ADDITIONhexane (1.5 L) is added
  6. 6
    Otherforming a precipitate, which
  7. 7
    Filtrationis then filtered
  8. 8
    Otherdried under vacuum

Procedure

A mixture of p-nitrobenzoic acid (500 g, 3.0 moles, 1 equiv) and thionyl chloride (600 mL, 8.2 moles, 2.73 equiv) is heated to reflux for approximately 6-7 hours until a clear solution is obtained. Excess of thionyl chloride is removed by distillation followed by co-distillation with toluene (300 mL). The reaction mass is cooled to room temperature, and hexane (1.5 L) is added, forming a precipitate, which is then filtered and dried under vacuum, yielding 4-nitrobenzoyl chloride as a yellow solid (530 g, approximately 100% yield), which is used without any further purification.

Source

DOI: 10.6084/m9.figshare.5104873.v1Patent: US08741048B2uspto-grants-2014_06