Reaction #465673

ord-4e7a78235a094b98b9fdb25f1cc51634

Reaction equation

[Br-].[Na+]
sodium bromide
O=C(CBr)c1ccccc1
phenacyl bromide
[F][Sb-]([F])([F])([F])([F])[F].[Na+]
sodium hexafluoroantimonate
CCCCCCCCCCCCCCCCCCSC
methyl octadecyl sulfide
CCCCCCCCCCCCCCCCCC[S+](C)CC(=O)c1ccccc1.[F][Sb-]([F])([F])([F])([F])[F]
desired salt
CCCCCCCCCCCCCCCCCC[S+](C)CC(=O)c1ccccc1.[F][Sb-]([F])([F])([F])([F])[F]
Methyl Octadecylphenacylsulfonium Hexafluoroantimonate

Conditions

Detailed conditions
See reaction.notes.procedure_details.

Workup

  1. 1
    TemperatureThe reaction mixture was heated
  2. 2
    Temperaturemaintained at this temperature for 30 minutes
  3. 3
    Otherto precipitate
  4. 4
    FiltrationThe reaction mixture was filtered
  5. 5
    Otherto remove the inorganic salts
  6. 6
    Otherthe resulting solution placed on a rotary evaporator
  7. 7
    Otherto remove solvents
  8. 8
    OtherThe product crystallized

Procedure

In a 100 mL Erlenmeyer flask were combined 10 g (0.05 mol) phenacyl bromide, 12.93 g (0.05 mol) sodium hexafluoroantimonate, 15 g (0.05 mol) methyl octadecyl sulfide and 40 mL methyl ethyl ketone (2-butanone). The reaction mixture was heated to boiling and maintained at this temperature for 30 minutes. During this time, sodium bromide was observed to precipitate. The reaction mixture was filtered to remove the inorganic salts and the resulting solution placed on a rotary evaporator to remove solvents. The product crystallized to give the desired salt, m.p. 80-82° C. Recrystallization from isopropanol gave a very light tan salt with a melting point of 79-80° C.

Source

DOI: 10.6084/m9.figshare.5104873.v1Patent: US06031014uspto-grants-2000_02