Reaction #2316915

ord-ee8f535af90c441e8d6bf5517e70e291

Reaction equation

[C+]1=C(c2ccccc2)C1(c1ccccc1)c1ccccc1.[Cl-]
triphenylcyclopropenylium chloride
[F][Sb-]([F])([F])([F])([F])[F].[Na+]
sodium hexafluoroantimonate
[C+]1=C(c2ccccc2)C1(c1ccccc1)c1ccccc1.[Cl-]
triphenylcyclopropenylium chloride
[C+]1=C(c2ccccc2)C1(c1ccccc1)c1ccccc1.[F][Sb-]([F])([F])([F])([F])[F]
Triphenylcyclopropenylium hexafluoroantimonate

Conditions

Detailed conditions
See reaction.notes.procedure_details.

Workup

  1. 1
    OtherNaCl was removed by filtration
  2. 2
    Washwashed with CH3CN
  3. 3
    workup.ADDITIONTo the filtrate was added ether
  4. 4
    FiltrationAfter filtration
  5. 5
    Othera white, very light yellow solid was obtained
  6. 6
    Otherwas between about 319 and 321° C.

Procedure

Triphenylcyclopropenylium hexafluoroantimonate was synthesized by the metatheses of triphenylcyclopropenylium chloride with sodium hexafluoroantimonate in acetonitrile. 0.003 moles of the triphenylcyclopropenylium chloride (literature) of Example 1 and 0.0031 moles of SbF6 was each separately dissolved in 10 ml of CH3CN and then combined. NaCl was removed by filtration and washed with CH3CN. To the filtrate was added ether. After filtration, a white, very light yellow solid was obtained. The melting point of this solid was between about 319 and 321° C.

Source

DOI: 10.6084/m9.figshare.5104873.v1Patent: US06420460B1uspto-grants-2002_07