Reaction #1121717

ord-6443f120eee842b89ebc7183e3ed6996

Reaction equation

[Cl-].[NH4+]
ammonium chloride
O=S(Cl)Cl
thionyl chloride
C=CC(=O)OCCCCCCOc1ccc(C(=O)O)cc1
4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid
Oc1ccc(OCCCCCCBr)cc1
4-(6-bromohexyloxy)phenol
C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCBr)cc2)cc1
4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate
Yield 59.9%

Conditions

Detailed conditions
See reaction.notes.procedure_details.

Workup

  1. 1
    Otherwas adjusted to a temperature of 0° C. (Celsius)
  2. 2
    workup.STIRRINGstirred at 0° C. (Celsius) for 1 hour
  3. 3
    workup.STIRRINGstirred at a room temperature overnight
  4. 4
    OtherThe resulting reaction mixture
  5. 5
    Extractionwas extracted three times with ethyl acetate (50 ml (milliliters)), and waster
  6. 6
    Otherwas removed over magnesium sulfate
  7. 7
    OtherThen, the solvents were evaporated
  8. 8
    Otherthe resulting reaction mixture
  9. 9
    Otherwas then purified

Procedure

4-{[6-(acryloyloxy)hexyl]oxy}benzoic acid (4) (2.8 g (grams)) was dissolved in tetrahydrofurane (THF, 100 ml (milliliters)) at a room temperature, and a temperature of the resulting mixture was adjusted to a temperature of 0° C. (Celsius). Then, thionyl chloride (12 ml (milliliters), 1M in THF) was added to the mixture, and stirred for 30 minutes. Then, 4-(6-bromohexyloxy)phenol (2.5 g (grams)) and triethyl amine (13 ml (milliliters)) were added to the resulting reaction mixture, stirred at 0° C. (Celsius) for 1 hour, and then stirred at a room temperature overnight. Next day, a saturated ammonium chloride aqueous solution was poured into the reaction mixture, and the reaction was completed. The resulting reaction mixture was extracted three times with ethyl acetate (50 ml (milliliters)), and waster was removed over magnesium sulfate. Then, the solvents were evaporated, and the resulting reaction mixture was then purified using a column chromatography (developer solution: ethylacetate/hexane=1/2 volume ratio) to obtain 4-(6-bromo hexyloxy)phenyl 4-{[6-(acryloyloxy)hexyl]oxy}benzoate (5) (3 g (grams)).

Source

DOI: 10.6084/m9.figshare.5104873.v1Patent: US08545717B2uspto-grants-2013_10