Reaktion #963284

ord-af598700f1474089bd99f31c96eca2bd

Reaktionsgleichung

O=C(N=C=S)c1ccccc1
benzoyl isothiocyanate
CO[Si](CCCN)(OC)OC
3-aminopropyl trimethoxysilane
CCC[Si](OC)(OC)OC.NC(=S)NC(=O)c1ccccc1
Benzoyl Thiourea Propyltrimethoxysilane
Ausbeute 97.0%

Reaktionsbedingungen

Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    SonstigeTo a 250 mL 3-neck RBF equipped with a condenser, magnetic stirrer
  2. 2
    Sonstigethermo-probe, nitrogen purge
  3. 3
    workup.ADDITIONwere added slowly over a period of time of 30 minutes
  4. 4
    SonstigeThe ice-water bath was removed
  5. 5
    Sonstigepurge overnight
  6. 6
    EinengenThe reaction mixture was then concentrated in vacuo at a temperature of 40° C.
  7. 7
    Sonstigeto provide a clear red liquid
  8. 8
    SonstigeThe liquid was dried to constant weight in vacuo at a temperature of 50° C.

Vorschrift

To a 250 mL 3-neck RBF equipped with a condenser, magnetic stirrer, thermo-probe, nitrogen purge and pressure-equilibrated addition funnel was added benzoyl isothiocyanate (25.0 g, 0.150 mol) followed by dichloromethane (100 mL). The reaction mixture was cooled in an ice-water bath to a temperature below 5° C., at which point 3-aminopropyl trimethoxysilane (27.7 g, 0.150 mol) and dichloromethane (100 mL) were added slowly over a period of time of 30 minutes. The ice-water bath was removed and the reaction mixture was stirred at room temperature under a nitrogen purge overnight. The reaction mixture was then concentrated in vacuo at a temperature of 40° C. to provide a clear red liquid. The liquid was dried to constant weight in vacuo at a temperature of 50° C. and a pressure of <1 mTorr in a 97% yield.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US08986847B2uspto-grants-2015_03