Reaktion #934012

ord-71a0f1c9aef04ff1aa2bc04c45d3dc3c

Reaktionsgleichung

COC(=O)c1ccc(-c2cccc(C(=O)OC)c2)cc1
Dimethyl 3,4'-biphenyldicarboxylate
COC(=O)c1ccc(-c2ccc(C(=O)OC)cc2)cc1
dimethyl 4,4'-biphenyldicarboxylate
OCCCCO
1,4-butanediol
O=C1OCCCCOC(=O)c2ccc(cc2)-c2ccc1cc2
butylene 4,4'-biphenyldicarboxylate

Reaktionsbedingungen

Temperatur
281°CELSIUS
Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Sonstigeequipped with a paddle stirrer
  2. 2
    Temperatur15-cm heated
  3. 3
    workup.DISTILLATIONVigreux column, distillation head, condenser
  4. 4
    SonstigeThe apparatus is evacuated
  5. 5
    workup.ADDITIONrefilled with nitrogen three times
  6. 6
    SonstigeA molten salt bath preheated to 220° C.
  7. 7
    Temperaturis raised around the flask
  8. 8
    workup.DISTILLATIONto distill and after 20 minutes
  9. 9
    Sonstige7.0 mL is collected
  10. 10
    workup.DISTILLATIONThe excess 1,4-butanediol distills
  11. 11
    Temperaturviscosity of the reaction mass slowly increases
  12. 12
    Sonstigethe polymer melt quickly crystallizes to an opaque white solid which

Vorschrift

Dimethyl 3,4'-biphenyldicarboxylate (5.41 g, 0.0200 mole), 21.62 g (0.0800 mole) of dimethyl 4,4'-biphenyldicarboxylate, 18.24 g (0.200 mole) of 1,4-butanediol and 20 μL of titanium tetraisopropoxide are added to a 100-mL round bottom flask equipped with a paddle stirrer, 15-cm heated Vigreux column, distillation head, condenser and graduated receiver. The apparatus is evacuated and refilled with nitrogen three times. A molten salt bath preheated to 220° C. is raised around the flask and after the monomers have melted, the stirrer is started. Methanol begins to distill and after 20 minutes, 7.0 mL is collected. During the next 27 minutes, the temperature is increased to 281° C. then the pressure is slowly reduced to 1 mm Hg. The excess 1,4-butanediol distills and viscosity of the reaction mass slowly increases. After an additional 8 minutes, the clear colorless polymer melt becomes very viscous and the polymerization is stopped. As it cools, the polymer melt quickly crystallizes to an opaque white solid which is then ground to a course powder. The polymer's inherent viscosity is 1.16 dL/g and its peak melting point is 266° C.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US05138022uspto-grants-1992_08