Reaktion #6329

ord-7b19ffcc5e3d49d7a3afa6d58e690d43

Reaktionsgleichung

CC(=O)OC(C)=O
Acetic anhydride
CC(=O)NCC1OC(=O)N2c3ccccc3CC12
N-[(9,9a-dihydro-3-oxo-1H,3H-oxazolo[3,4-a]indol-1-yl)methyl]acetamide
O=C([O-])O.[Na+]
sodium bicarbonate
CC(=O)NCC1OC(=O)N2c3ccc(C(C)=O)cc3CC12
title compound
CC(=O)NCC1OC(=O)N2c3ccc(C(C)=O)cc3CC12
N-[(7-acetyl-9,9a-dihydro-3-oxo-1H,3H-oxazolo[3,4-a]indol-1-yl)methyl]acetamide

Reaktionsbedingungen

Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Temperaturto warm to 20°-25° during this time
  2. 2
    workup.ADDITIONAt the end of this time, a small amount of ice is added
  3. 3
    workup.ADDITIONis added slowly
  4. 4
    SonstigeThe solvent layers are separated
  5. 5
    Extraktionthe aqueous layer is extracted with additional methylene chloride (7×1 ml)
  6. 6
    TrocknenThe combined organic layers are dried over magnesium sulfate
  7. 7
    Einengenconcentrated
  8. 8
    Sonstigeto provide an oil
  9. 9
    SonstigeThis oil is purified on a silica preparative plate (1000μ)

Vorschrift

Acetic anhydride (91 μl) is added to a mixture of (±) (1S,9aS/1R,9aR) N-[(9,9a-dihydro-3-oxo-1H,3H-oxazolo[3,4-a]indol-1-yl)methyl]acetamide (X diastereomer B, EXAMPLE 11, 74 mg) in methane sulfonic acid (1 ml) at 0° over 1 minute. The mixture is stirred for 20.5 hours and allowed to warm to 20°-25° during this time. At the end of this time, a small amount of ice is added and the mixture is diluted with methylene chloride. To this mixture of sodium bicarbonate (2.4 g) is added slowly. The solvent layers are separated and the aqueous layer is extracted with additional methylene chloride (7×1 ml). The combined organic layers are dried over magnesium sulfate and concentrated to provide an oil. This oil is purified on a silica preparative plate (1000μ) by developing it in methanol/methylene chloride (5/95, 3×) which provides the title compound, NMR (CDCl3, 300 MHz) 7.88, 7.84, 7.43, 6.40, 4.62, 4.57, 3.75, 3.36, 3.13, 2.58 and 2.08 δ; CMR (CDCl3, 75.47 MHz) 23.15, 26.62, 34.24, 41.02, 61.84, 83.26, 114.37, 125.53, 129.86, 132.98, 134.2, 144.1, 154.7, 170.6 and 196.5 δ; IR (CHCl3) 3660, 3440, 2980, 2920, 1760, 1670, 1600, 1480, 1420, 1350, 1260, 1120, 1050, 980 and 700 cm-1 ; MS (m/e) 288, 244, 229, 216, 201, 185, 170, 160, 144, 130, 118, 85, 73 and 43, exact mass calcd for C15H16 --N2O4 (288.1110), found 288.1105.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US05247090uspto-grants-1993_09