Reaktion #599920

ord-53441e8cbe3f4f73aa8ae33b3be57fd4

Reaktionsgleichung

CC[O-].[Na+]
sodium ethoxide
Cl.Cl.NNc1cccnc1
3-Hydrazinopyridine.dihydrochloride
CCOC(=O)/C=C\C(=O)OCC
diethyl maleate
CCOC(=O)C1CC(=O)NN1c1cccnc1
Ethyl 5-oxo-2-(pyridin-3-yl)pyrazolidine-3-carboxylate

Reaktionsbedingungen

Temperatur
20°CELSIUS
Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Sonstigefrom 20° C. to 32° C
  2. 2
    Temperaturthe reaction was heated at 60° C. for 3 hours
  3. 3
    TemperaturThe reaction was cooled to 20° C.
  4. 4
    Sonstigequenched with acetic acid
  5. 5
    workup.ADDITIONThe reaction mixture was diluted with water (100 mL)
  6. 6
    Extraktionextracted with ethyl acetate (3×100 mL)
  7. 7
    EinengenThe combined organics were concentrated to dryness
  8. 8
    Sonstigethe residue was purified by flash column chromatography

Vorschrift

A 4-neck round bottomed flask (250 mL) was charged with sodium ethoxide (21 wt % in ethanol, 56 mL, 192 mmol). 3-Hydrazinopyridine.dihydrochloride (10.0 g, 55.0 mmol) was added, causing an exotherm from 20° C. to 32° C. The reaction was allowed to cool to 20° C. and diethyl maleate (13.4 mL, 82.0 mmol) was added, and the reaction was heated at 60° C. for 3 hours. The reaction was cooled to 20° C. and quenched with acetic acid. The reaction mixture was diluted with water (100 mL) and extracted with ethyl acetate (3×100 mL). The combined organics were concentrated to dryness and the residue was purified by flash column chromatography using ethyl acetate as eluent to the title compound as a blue oil (6.60 g, 51%): 1H NMR (400 MHz, DMSO-d6) δ 10.40 (s, 1H), 8.40-8.26 (m, 1H), 8.19 (dd, J=4.4, 1.6 Hz, 1H), 7.47-7.21 (m, 2H), 4.77 (dd, J=9.8, 2.1 Hz, 1H), 4.22 (qd, J=7.1, 1.7 Hz, 2H), 3.05 (dd, J=17.0, 9.8 Hz, 1H), 1.99 (s, 1H), 1.25 (t, J=7.1 Hz, 3H); 13C NMR (101 MHz, DMSO-d6) δ 170.37, 146.60, 142.60, 137.28, 123.54, 121.94, 65.49, 61.32, 32.15, 20.72, 13.94; ESIMS m/z 236 ([M+H]+).

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US09102654B2uspto-grants-2015_08