Reaktion #50253

ord-2ebf45a8edb24173949e235cca7efcf1

Reaktionsgleichung

CC(C)(C)C(=O)Cl
Pivaloyl chloride
O=C1NCCO1
oxazolidinone
O=C1N[C@H](Cc2ccccc2)CO1
(R)-4-benzyl-2-oxazolidinone
[Li][CH2]CCC
butyl lithium
CCN(CC)CC
triethylamine
CC(=O)SC[C@H]1CCCCCC[C@H](C(=O)O)NC1=O
Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid
CC(=O)SC[C@H]1CCCCCC[C@H](C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)NC1=O
N-[[trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecan-10-yl]-carbonyl]-(R)-4-benzyl-2-oxazolidinone

Reaktionsbedingungen

Temperatur
-78°CELSIUS
Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Temperaturthe reaction is warmed to 0° C.
  2. 2
    Temperaturcooled down again to -78° C
  3. 3
    Temperaturcooled to -78° C.
  4. 4
    workup.STIRRINGthe reaction is stirred at -78° C. for 30 minutes
  5. 5
    workup.STIRRINGis stirred at -78° C. for an additional 1 hour
  6. 6
    Temperaturto warm up to room temperature
  7. 7
    workup.STIRRINGstir overnight
  8. 8
    SonstigeThe reaction is quenched with saturated ammonium chloride
  9. 9
    Sonstigeall of the solvent is evaporated
  10. 10
    SonstigeThe product is purified by an initial silica gel chromatography (50% ethyl acetate/hexane)

Vorschrift

Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid (2.90 g, 10.1 mmol) is dissolved in tetrahydrofuran (45.0 mL), triethylamine (1.48 mL, 10.2 mmol) is added, and the reaction is cooled to -78° C. Pivaloyl chloride (1.31 mL, 10.2 mmol) is added, the reaction is warmed to 0° C., stirred for 3 hours, and then cooled down again to -78° C. Meanwhile, in a separate flask, (R)-4-benzyl-2-oxazolidinone (1.88 g, 10.2 mmol) is dissolved in tetrahydrofuran (35 mL) and cooled to -78° C.; butyl lithium (6.63 mL of a 1.6M solution in hexane, 10.2 mmol) is added and the reaction is stirred at -78° C. for 30 minutes. This oxazolidinone anion is then cannulated into the first reaction flask, which is stirred at -78° C. for an additional 1 hour, and then allowed to warm up to room temperature and stir overnight. The reaction is quenched with saturated ammonium chloride, and all of the solvent is evaporated. The product is purified by an initial silica gel chromatography (50% ethyl acetate/hexane) to give N-[[trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecan-10-yl]-carbonyl]-(R)-4-benzyl-2-oxazolidinone as a mixture of two chiral diastereomers. These diastereomers are then separated by another silica gel chromatography (15% ether/40% hexane/45% methylene chloride) to yield the less polar (minor) chiral isomer, and the more polar (major) chiral isomer, m.p. 65°-66° C., [α]D +10.97° (c=7.52 mg/ml, CH2Cl2) leading to the more active NEP inhibiting enantiomer.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US05426103uspto-grants-1995_06