Reaktion #50246

ord-dc383267497f4e0695dcbf04fc46f7bb

Reaktionsgleichung

CC(=O)SC[C@H]1CCCCCC[C@H](C(=O)O)NC1=O
Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid
CN1CCOCC1
4-Methylmorpholine
CCOC(=O)Cl
Ethyl chloroformate
CC(=O)SC[C@H]1CCCCCC[C@H](C(N)=O)NC1=O
trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide

Reaktionsbedingungen

Temperatur
-20°CELSIUS
Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    FiltrationThe reaction is then filtered
  2. 2
    Einengenthe filtrate is concentrated
  3. 3
    Sonstigeto give a yellow oil
  4. 4
    Sonstigeanhydrous ammonia gas is bubbled through the solution for 1 hour
  5. 5
    workup.STIRRINGthe reaction is stirred an additional 1 hour
  6. 6
    SonstigeThe solvent is evaporated
  7. 7
    Sonstigethe residue is partitioned between ethyl acetate and water
  8. 8
    ExtraktionThe aqueous layer is extracted several times with ethyl acetate
  9. 9
    Trocknenthe combined organic layers are dried (Na2SO4)
  10. 10
    Sonstigethe solvent is evaporated

Vorschrift

Trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxylic acid (0.30 g, 1.05 mmol) is dissolved in tetrahydrofuran (5.0 mL). 4-Methylmorpholine (0.14 mL, 1.05 mmol) is then added, and the reaction is cooled to -20° C. Ethyl chloroformate (0.1 mL, 1.05 mmol) is then added, and the reaction is stirred at -20° C. for 30 minutes. The reaction is then filtered, and the filtrate is concentrated to give a yellow oil. This oil is dissolved in methylene chloride (20.0 mL), and anhydrous ammonia gas is bubbled through the solution for 1 hour. The bubbling is stopped, and the reaction is stirred an additional 1 hour. The solvent is evaporated, and the residue is partitioned between ethyl acetate and water. The aqueous layer is extracted several times with ethyl acetate, the combined organic layers are dried (Na2SO4), and the solvent is evaporated to give trans 3-(acetylthiomethyl)-2-oxo-1-azacyclodecane-10-carboxamide, MS: M+1=287.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US05426103uspto-grants-1995_06