Reaktion #2507807

ord-26b89ab8a82042879e5da0efaffe1a92

Reaktionsgleichung

NCCCCCC(=O)O
6-aminocaproic acid
O=C1CCCCCN1
caprolactam
NCCCCCCN.O=C(O)CCCCC(=O)O
adipic acid hexamethylene diamine
NCCCCCCN.O=C(O)CCCCC(=O)O.O=C1CCCCCN1
nylon 6/66

Reaktionsbedingungen

Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Sonstigephase polymerization from a diacid-diamine complex which
  2. 2
    Sonstigemay be prepared either in situ or in a separate step
  3. 3
    Sonstigethe reaction
  4. 4
    TemperaturThe mixture is then heated to the polymerization temperature
  5. 5
    Sonstigethe polymerization

Vorschrift

Any method known in the art can be used to produce the polyamides. The polyamides are generally prepared by melt phase polymerization from a diacid-diamine complex which may be prepared either in situ or in a separate step. In either method, the diacid and diamine are used as starting materials. Alternatively, an ester form of the diacid may be used, preferably the dimethyl ester. If the ester is used, the reaction must be carried out at a relatively low temperature, generally 80 to 120° C., until the ester is converted to an amide. The mixture is then heated to the polymerization temperature. In the case of polycaprolactam, either caprolactam or 6-aminocaproic acid can be used as a starting material and the polymerization may be catalyzed by the addition of adipic acid/hexamethylene diamine salt which results in a nylon 6/66 copolymer. When the diacid-diamine complex is used, the mixture is heated to melting and stirred until equilibration.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US07955533B2uspto-grants-2011_06