Reaktion #218247

ord-1bdfd983426b4bb9b1c6993dca6f8b5c

Reaktionsgleichung

O=S(=O)([O-])[O-].[Co+2]
cobalt sulfate
O=S(=O)([O-])[O-].[Ni+2]
nickel sulfate
O=S(=O)([O-])[O-].[Mn+2]
manganese sulfate
O=S(=O)([O-])[O-].[NH4+].[NH4+]
ammonium sulfate
[Na+].[OH-]
sodium hydroxide
[Co+2].[Mn+2].[Ni+2].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-]
nickel-manganese-cobalt hydroxide

Reaktionsbedingungen

Temperatur
50°CELSIUS
Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    Sonstigeobtained in the above-described Example 1
  2. 2
    workup.ADDITIONwas poured
  3. 3
    Temperaturwas maintained at 11.05±0.05
  4. 4
    ExtraktionThe mother liquor in the reaction vessel was periodically extracted
  5. 5
    Einengenthe slurry was concentrated until the final
  6. 6
    Einengenslurry concentration
  7. 7
    EinengenThe nickel concentration in the periodically extracted mother liquor from the reaction vessel
  8. 8
    EinengenAfter the target slurry concentration
  9. 9
    Sonstigehad been obtained
  10. 10
    Filtrationfiltration and water washing

Vorschrift

In a 2-L (liter) reaction vessel, 1.8 L of the mother liquor obtained in the above-described Example 1 was poured, and agitated at 250 rpm while maintaining the internal temperature at 50±1° C. To this, while supplying an aqueous solution of metal sulfates containing 1.5 mol/L of nickel sulfate, 1.5 mol/L of manganese sulfate and 1.5 mol/L of cobalt sulfate at a flow rate of 0.4 L/hr; and simultaneously supplying a 1.5 mol/L aqueous solution of ammonium sulfate at a flow rate of 0.03 L/hr; an 18 mol/L aqueous solution of sodium hydroxide was continuously supplied so that the pH in the reaction vessel was maintained at 11.05±0.05. The mother liquor in the reaction vessel was periodically extracted, and the slurry was concentrated until the final slurry concentration became about 1000 g/L. The nickel concentration in the periodically extracted mother liquor from the reaction vessel was 22 ppm. After the target slurry concentration had been obtained, the slurry was aged at 50° C. for 5 hours, filtration and water washing were repeated to obtain coagulated particles of a co-precipitated nickel-manganese-cobalt hydroxide.

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US07384706B2uspto-grants-2008_06