Reaktion #1857550

ord-c33200089daf434cb1aba83d99804c0a

Reaktionsgleichung

COC(=O)[C@@H](CCC(C)C)[C@H](C)O
(S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate
CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2
((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid
COc1ccc(COC(=N)C(Cl)(Cl)Cl)cc1
4-methoxybenzyl 2,2,2-trichloroacetimidate
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
title compound
Ausbeute 77.0%
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
(S)-methyl 2-((S)-1-((4-methoxybenzyl)oxy)ethyl)-5-methylhexanoate
Ausbeute 77.0%

Lösungsmittel

Reaktionsbedingungen

Detaillierte Bedingungen
See reaction.notes.procedure_details.

Aufarbeitung

  1. 1
    SonstigeThe reaction mixture was removed from the cold bath
  2. 2
    workup.ADDITIONHexane (50 mL) was added to the reaction
  3. 3
    Sonstigethe precipitate was removed by filtration
  4. 4
    WaschenThe solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls)
  5. 5
    workup.ADDITIONwas added to the combined filtrate and washes
  6. 6
    Sonstigethe solvent was removed under reduced pressure
  7. 7
    Sonstigepurified

Vorschrift

To a solution of (S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate (5.00 g, 26.6 mmol) and ((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid (camphorsulfonic acid, CSA; 0.617 g, 2.66 mmol) in DCM (53.1 mL) was added 4-methoxybenzyl 2,2,2-trichloroacetimidate (8.27 mL, 39.8 mmol) at 0° C. The reaction mixture was removed from the cold bath and stirred at room temperature for 17 h. Hexane (50 mL) was added to the reaction and the precipitate was removed by filtration. The solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls) was added to the combined filtrate and washes, and the solvent was removed under reduced pressure. The resulting adsorbed material was directly loaded onto a column and purified using flash column chromatography (80 g SiO2, 0→35% EtOAc/hexanes) to afford the title compound (6.3 g, 20.4 mmol, 77%) as a colorless oil; 1H NMR (400 MHz, CDCl3) δ 7.24-7.16 (m, 2H), 6.89-6.79 (m, 2H), 4.49 (d, J=11.2 Hz, 1H), 4.33 (d, J=11.1 Hz, 1H), 3.75 (s, 3H), 3.74-3.62 (m, 4H), 2.49 (ddd, J=10.7, 8.2, 4.0 Hz, 1H), 1.62-1.40 (m, 3H), 1.23-1.16 (m, 3H), 1.16-1.03 (m, 2H), 0.87 (d, J=3.9 Hz, 3H), 0.85 (d, J=3.9 Hz, 3H); 13C NMR (101 MHz, CDCl3) δ 175.03, 159.10, 130.63, 129.14, 113.62, 76.16, 70.71, 55.11, 52.64, 51.25, 36.58, 27.97, 26.00, 22.69, 22.17, 17.08; ESIMS m/z 331 ([M+Na]+).

Quelle

DOI: 10.6084/m9.figshare.5104873.v1Patent: US09247741B2uspto-grants-2016_02