Reaktion #10650

Reaktionsgleichung

Intermediate 92

N-(tert-butoxycarbonyl)-N′-(4-chloro-5-isoquinolyl)-1,4-cyclohexanediamine

hydrogen chloride methanol

→

title compound

N-(4-chloro-5-isoquinolyl)-1,4-cyclohexanediamine hydrochloride

Reaktionsbedingungen

Aufarbeitung

1. 1
   Sonstige(room temperature, 2 hours)
2. 2
   SonstigeThe solvent was evaporated under reduced pressure
3. 3
   workup.ADDITIONthe residue was added with methanol (1 ml) and diethyl ether (3 ml)
4. 4
   SonstigeThe deposited precipitates
5. 5
   Filtrationwere collected by filtration
6. 6
   Waschenwashed with diethyl ether

Vorschrift

According to the method of Example 1, Step C, deprotection was performed (room temperature, 2 hours) by using Intermediate 92 (40.4 mg) and 10% hydrogen chloride/methanol solution (2 ml). The solvent was evaporated under reduced pressure, and the residue was added with methanol (1 ml) and diethyl ether (3 ml). The deposited precipitates were collected by filtration and washed with diethyl ether to obtain the title compound (37.8 mg) as light yellow powdery solid.

Quelle