تفاعل #985244

ord-943b16cb7d5b46f6a0f07b568d191b7f

معادلة التفاعل

[N-]=[N+]=[N-].[Na+]
sodium azide
Cc1ccc(S(=O)(=O)Cl)cc1
p-toluenesulfonyl chloride
Cc1ccc(S(=O)(=O)N=[N+]=[N-])cc1
title compound
المردود 80.3%
Cc1ccc(S(=O)(=O)N=[N+]=[N-])cc1
p-toluenesulfonylazide
المردود 80.3%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONwas added dropwise at 10-25° C.
  2. 2
    أخرىfollowed by reaction at room temperature for 2.5 hours
  3. 3
    تركيزThe reaction solution was concentrated at room temperature under reduced pressure
  4. 4
    غسيلThe resulting oily residue was washed with H2O several times
  5. 5
    تجفيفdried over anhydrous MgSO4
  6. 6
    أخرىAfter removing the drying agent
  7. 7
    ترشيحby filtration

الإجراء التجريبي

After dissolving sodium azide (22.5 g, 0.35 mole) in a small amount of H2O, the resulting solution was diluted with a 90% ethanol aqueous solution (130 ml). To this, an ethanol solution dissolving p-toluenesulfonyl chloride (60 g, 0.32 mole) was added dropwise at 10-25° C., followed by reaction at room temperature for 2.5 hours. The reaction solution was concentrated at room temperature under reduced pressure. The resulting oily residue was washed with H2O several times and dried over anhydrous MgSO4. After removing the drying agent by filtration, there was obtained 50.7 g of the title compound as a colorless oil.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: USRE040211E1uspto-grants-2008_04