تفاعل #969871

ord-1d9cbc1e1d9147ca9ea21a20f076b4ed

معادلة التفاعل

CC1=C(C=O)C(C)(C)C(C)CC1
2,5,6,6-Tetramethyl-cyclohexene carbaldehyde
C1CCCCC1
cyclohexane
Cc1ccc(S(=O)(=O)O)cc1
p-toluene sulfonic acid
CC1=C(C2OCCO2)C(C)(C)C(C)CC1
2-(2,5,6,6-tetramethyl-cyclohexenyl)-1,3-dioxolane

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىequipped with a heating circulator, temperature probe, mechanical stirring device
  2. 2
    درجة الحرارةThe biphasic mixture was heated
  3. 3
    درجة الحرارةto reflux
  4. 4
    درجة الحرارةAfter 8 hours reflux the reaction
  5. 5
    تركيزwas concentrated under vacuum in order
  6. 6
    أخرىto remove cyclohexane
  7. 7
    أخرىcrude 2-(2,5,6,6-tetramethyl-cyclohexenyl)-1,3-dioxolane was obtained in 80% GC purity as a 80/7/13 trans 2-enyl/cis 2-en/1-enyl isomers mixture
  8. 8
    workup.DISTILLATIONFlash distillation

الإجراء التجريبي

2,5,6,6-Tetramethyl-cyclohexene carbaldehyde (64/7/29 trans 2-ene/cis 2-ene/1-ene isomers mixture) (1660 g, 10 mol., 1 eq.), ethylene glycol (1240 g, 20 mol., 2 eq.), cyclohexane (1660 g) and p-toluene sulfonic acid monohydrate (7.6 g, 0.04 mol., 0.004 eq.) were loaded altogether in a 10 liter schmizo type reactor equipped with a heating circulator, temperature probe, mechanical stirring device and a Dean-stark apparatus. The biphasic mixture was heated to reflux under vigorous stirring with azeotropic water removal from reaction mixture. After 8 hours reflux the reaction was then cooled down to room temperature. After decantation of the bottom phase containing excess ethylene glycol and p-toluene sulfonic acid the upper phase was concentrated under vacuum in order to remove cyclohexane and crude 2-(2,5,6,6-tetramethyl-cyclohexenyl)-1,3-dioxolane was obtained in 80% GC purity as a 80/7/13 trans 2-enyl/cis 2-en/1-enyl isomers mixture. Flash distillation afforded 1940 g of 2-(2,5,6,6-tetramethyl-cyclohexenyl)-1,3-dioxolane along with 60 g of residual heavy by-products formed during the reaction.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08236749B2uspto-grants-2012_08