تفاعل #939052

ord-4ebe257bacd840edbeb9a32ed2682b23

معادلة التفاعل

Cl
hydrochloric acid
[Na+].[OH-]
sodium hydroxide
COC(=O)c1cccc(NC(=O)c2ccc(OCC(C)C)c(C#N)c2)c1N
methyl 3-(3-cyano-4-isobutyloxybenzoylamino)anthranilate
CC(C)COc1ccc(-c2nc3c(C(=O)O)cccc3[nH]2)cc1C#N
desired compound
CC(C)COc1ccc(-c2nc3c(C(=O)O)cccc3[nH]2)cc1C#N
2-(3-Cyano-4-isobutyloxyphenyl)benzimidazole-7-carboxylic acid

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةunder reflux for 2 hours
  2. 2
    درجة الحرارةcooled
  3. 3
    workup.DISTILLATIONto distill the solvent off
  4. 4
    workup.DISTILLATIONto distill the solvent off
  5. 5
    workup.ADDITIONTo the residue were added ethyl acetate and water
  6. 6
    تجفيفdried over anhydrous magnesium sulfate
  7. 7
    workup.DISTILLATIONto distill the solvent off
  8. 8
    غسيلThe residue was washed with hot toluene
  9. 9
    أخرىto give

الإجراء التجريبي

A solution of methyl 3-(3-cyano-4-isobutyloxybenzoylamino)anthranilate (341 mg, 0.93 mmol) in glacial acetic acid (10 mL) was heated under reflux for 2 hours, cooled, and placed under reduced pressure to distill the solvent off. To the residue was added a solution of sodium hydroxide (240 mg, 10 mmol) in methanol (20 mL), and the mixture was stirred for 5 hours at room temperature. The reaction mixture was made acidic by addition of aqueous 1M hydrochloric acid, and placed under reduced pressure to distill the solvent off. To the residue were added ethyl acetate and water. The organic portion was taken out, dried over anhydrous magnesium sulfate, and placed under reduced pressure to distill the solvent off. The residue was washed with hot toluene, to give 300 mg (yield 960) of the desired compound in the form of a pale yellow crystalline product.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07253154B2uspto-grants-2007_08