تفاعل #939047

ord-94383e7190154706ae5b27b85ba45317

معادلة التفاعل

CCOC(=O)c1ccc(OCC(C)C)c(C#N)c1
Ethyl 3-cyano-4-isobutyloxybenzoate
[Na+].[OH-]
sodium hydroxide
CC(C)Cc1ccc(C(=O)O)cc1C#N
desired compound
CC(C)Cc1ccc(C(=O)O)cc1C#N
3-Cyano-4-isobutylbenzoic acid

الكواشف

لا شيء

المذيبات

ظروف التفاعل

درجة الحرارة
30°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  2. 2
    workup.ADDITIONWater (100 mL) was added to the residue and further aqueous 2M hydrochloric acid
  3. 3
    أخرىto obtain
  4. 4
    workup.ADDITIONan aqueous mixture of pH 1
  5. 5
    ترشيحThe precipitated crystalline product was collected by filtration
  6. 6
    غسيلwashed with water (200 mL×2)
  7. 7
    أخرىdried in air

الإجراء التجريبي

Ethyl 3-cyano-4-isobutyloxybenzoate (20.0 g, 80.9 mmol) was dissolved in a mixture of ethanol (100 mL) and THF (100 mL). Aqueous 2M sodium hydroxide (45 mL, 90.0 mmol) was added to the resulting solution, and the mixture was stirred at 30° C. for 4 hours. The solvent was distilled off under reduced pressure. Water (100 mL) was added to the residue and further aqueous 2M hydrochloric acid to obtain an aqueous mixture of pH 1. The precipitated crystalline product was collected by filtration, washed with water (200 mL×2), and dried in air, to give 17.5 g (yield 99%) of the desired compound in the form of a white crystalline product.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07253154B2uspto-grants-2007_08