تفاعل #939041

ord-72a186cea1e94986b168aa974f6763a2

معادلة التفاعل

COC(=O)c1ccc(OCC(C)C)c([N+](=O)[O-])c1
Methyl 4-isobutyloxy-3-nitrobenzoate
[Na+].[OH-]
sodium hydroxide
CC(C)COc1ccc(C(=O)O)cc1[N+](=O)[O-]
desired compound
المردود 98.0%
CC(C)COc1ccc(C(=O)O)cc1[N+](=O)[O-]
4-Isobutyloxy-3-nitrobenzoic acid
المردود 98.0%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.DISTILLATIONThe solvent was distilled off under reduced pressure
  2. 2
    workup.ADDITIONwere added to the residue water (20 mL) and 3M aqueous hydrochloric acid
  3. 3
    ترشيحThe precipitated crystalline product was collected by filtration
  4. 4
    غسيلThe crystalline product was washed with water (20 mL×2)
  5. 5
    أخرىdried at 50° C. for 4 hours under reduced pressure

الإجراء التجريبي

Methyl 4-isobutyloxy-3-nitrobenzoate (2.50 g, 9.87 mmol) was dissolved in a mixture of methanol (10 mL) and 25 THF (10 mL). After addition of 2M aqueous sodium hydroxide (7.5 mL, 15.0 mmol), the solution was stirred for 18 hours at room temperature. The solvent was distilled off under reduced pressure, and were added to the residue water (20 mL) and 3M aqueous hydrochloric acid to adjust 30 the solution to pH 1. The precipitated crystalline product was collected by filtration. The crystalline product was washed with water (20 mL×2) and dried at 50° C. for 4 hours under reduced pressure, to give 2.31 g (yield 98%) of the desired compound in the form of a white crystalline product.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07253154B2uspto-grants-2007_08