تفاعل #93568

ord-082980ae059a41dbbd3375aa8ea50ec3

معادلة التفاعل

COc1ccc(-c2ccc(C(=O)C3CC=CC3)cc2)cc1
(3-cyclopenten-1-yl)(4'-methoxy-[1,1'-biphenyl]-4-yl)-methanone
NN.O
hydrazine hydrate
[K+].[OH-]
potassium hydroxide
Cl
hydrochloric acid
Oc1ccc(-c2ccc(CC3CC=CC3)cc2)cc1
4-(3-cyclopenten-1-ylmethyl)-4'-hydroxy-1,1'-biphenyl

المذيبات

ظروف التفاعل

درجة الحرارة
200°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةwas heated gently
  2. 2
    درجة الحرارةat reflux temperature for 45 min
  3. 3
    workup.DISTILLATIONThe low boiling material was distilled off
  4. 4
    درجة الحرارةthe mixture was heated
  5. 5
    أخرىThe cooled reaction mixture
  6. 6
    ترشيحthe resulting light brown precipitate was filtered off
  7. 7
    workup.DISSOLUTIONThis solid was dissolved in methylene dichloride
  8. 8
    غسيلThe solution was washed twice with water
  9. 9
    تجفيفdried (MgSO4)
  10. 10
    أخرىthe solvent was removed

الإجراء التجريبي

A mixture of (3-cyclopenten-1-yl)(4'-methoxy-[1,1'-biphenyl]-4-yl)-methanone (30 g), hydrazine hydrate (36 ml) and potassium hydroxide (36 g) in 2,2'-oxybisethanol (250 ml) was heated gently, at reflux temperature for 45 min. The low boiling material was distilled off and the mixture was heated under reflux, at 200° C. for 2 h. The cooled reaction mixture was poured into water, acidified with dilute hydrochloric acid and the resulting light brown precipitate was filtered off. This solid was dissolved in methylene dichloride. The solution was washed twice with water and dried (MgSO4), and the solvent was removed. Trituration of the residue with light petroleum gave 4-(3-cyclopenten-1-ylmethyl)-4'-hydroxy-1,1'-biphenyl as a buff solid (25.5 g). A small sample, recrystallised from ether-light petroleum had m.p. 138°-140° C.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US04613619uspto-grants-1986_09