تفاعل #84064

ord-5a3ee1ae877f442580d3e9b003e5e95e

معادلة التفاعل

COc1ccc2nc(-c3ccc(C(=O)O)cc3Cl)ccc2c1
3-chloro-4-(6-methoxyquinolin-2-yl)benzoic acid
[Al+3].[Cl-].[Cl-].[Cl-]
AlCl3
O=C(O)c1ccc(-c2ccc3cc(O)ccc3n2)c(Cl)c1
3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid
المردود 18.0%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThe reaction mixture was refluxed overnight
  2. 2
    أخرىThe mixture was quenched with saturated NH4Cl (10 mL)
  3. 3
    استخلاصthe aqueous layer was extracted with CH2Cl2/MeOH (v/v=10:1, 30 mL×3)
  4. 4
    غسيلThe combined organic layer was washed with brine
  5. 5
    تجفيفdried over Na2SO4
  6. 6
    ترشيحfiltered
  7. 7
    تركيزconcentrated
  8. 8
    أخرىto give the crude product, which
  9. 9
    أخرىwas purified by prep-HPLC (0.1% TFA as additive)

الإجراء التجريبي

To a suspension of 3-chloro-4-(6-methoxyquinolin-2-yl)benzoic acid (150 mg, 0.479 mmol) in anhydrous CH2Cl2 (5 mL) was added AlCl3 (320 mg, 2.40 mmol). The reaction mixture was refluxed overnight. The mixture was quenched with saturated NH4Cl (10 mL) and the aqueous layer was extracted with CH2Cl2/MeOH (v/v=10:1, 30 mL×3). The combined organic layer was washed with brine, dried over Na2SO4, filtered, and concentrated to give the crude product, which was purified by prep-HPLC (0.1% TFA as additive) to give 3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid (25 mg, yield 18%). 1H NMR (DMSO, 400 MHz): δ 10.20 (brs, 1H), 8.30 (d, J=8.4 Hz, 1H), 8.10-8.00 (m, 2H), 7.95 (d, J=9.2 Hz, 1H), 7.80 (d, J=8.0 Hz, 1H), 7.72 (d, J=8.8 Hz, 1H), 7.38 (dd, J=6.4, 2.8 Hz, 1H), 7.22 (d, J=2.4 Hz, 1H), MS (ESI): m/z 299.9 [M+H]+.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09433618B2uspto-grants-2016_09