تفاعل #80273

ord-d6d339541bde41239f4dbc25a36315a6

معادلة التفاعل

CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)OCc3ccccc3)c12
benzyl 5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylate
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)O)c12
desired compound
المردود 89.0%
CCOC(=O)c1c(C)oc2ccc(Oc3nc(OC)cc(OC)n3)c(C(=O)O)c12
5-(4,6-Dimethoxypyrimidin-2yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylic Acid
المردود 89.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىAfter completion of the reaction
  2. 2
    أخرىan insoluble matter was separated by filtration
  3. 3
    تركيزthe filtrate was concentrated under reduced pressure, whereupon the precipitated crystals
  4. 4
    غسيلwere washed with a solvent mixture of diethyl ether/n-hexane

الإجراء التجريبي

A mixture comprising 14.4 g of benzyl 5-(4,6-dimethoxypyrimidin-2-yl)oxy-3-ethoxycarbonyl-2-methylbenzofuran-4-carboxylate and 4.52 g of 10% palladium carbon in 100 ml of ethanol, was subjected to hydrogenation under an ordinary pressure while stirring at room temperature. After completion of the reaction, an insoluble matter was separated by filtration, and the filtrate was concentrated under reduced pressure, whereupon the precipitated crystals were washed with a solvent mixture of diethyl ether/n-hexane to obtain 10.47 g (yield: 89%) of the desired compound.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05616537uspto-grants-1997_04