تفاعل #79939

ord-617a67e1a15a474a9a2787df791f3888

معادلة التفاعل

CCOC(C)=O
ethyl acetate
CC(C)=CC(=O)Cl
3,3,-dimethyl acryloyl chloride
[H-].[Na+]
sodium hydride
Oc1ccc(Br)cc1
4-bromo phenol
CC(C)=CC(=O)Oc1ccc(Br)cc1
title compound
المردود 59.0%
CC(C)=CC(=O)Oc1ccc(Br)cc1
3-Methyl-but-2-enoic acid 4-bromo-phenyl ester
المردود 59.0%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةTo a stirred, cooled
  2. 2
    workup.ADDITIONwas added
  3. 3
    استخلاصextracted with diethyl ether (×2)
  4. 4
    تجفيفThe combined organic phase was dried over anhydrous sodium sulfate
  5. 5
    ترشيحfiltered
  6. 6
    أخرىevaporated in vacuo
  7. 7
    أخرىto afford an oil which

الإجراء التجريبي

To a stirred, cooled (ice bath) suspension of sodium hydride (2.4 g, 100 mmol) in anhydrous tetrahydrofuran (200 mL), 4-bromo phenol (17.3 g, 100 mmol) was added followed by 3,3,-dimethyl acryloyl chloride (11.14 mL, 100 mmol). After 4 hours at ambient temperature, the reaction mixture was poured into brine and extracted with diethyl ether (×2). The combined organic phase was dried over anhydrous sodium sulfate, filtered and evaporated in vacuo to afford an oil which was subjected to flash column chromatography over silica gel (230-400 mesh) using 2% ethyl acetate in hexane as the eluent to afford the title compound (15 g, 59%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06713647B2uspto-grants-2004_03