تفاعل #7707

ord-8eb6557b50af432584bae6d598ca99b8

معادلة التفاعل

CC(=O)Nc1ccc(Sc2nc(Nc3cc(C)n[nH]3)c3ccc([N+](=O)[O-])cc3n2)cc1
[2-(4-Acetamido-phenylsulfanyl)-7-nitroquinazolin-4-yl]-(5-methyl-2H-pyrazol-3-yl)-amine
CC(=O)Nc1ccc(Sc2nc(Nc3cc(C)n[nH]3)c3ccc(N)cc3n2)cc1
[2-(4-acetamido-phenylsulfanyl)-7-aminoquinazolin-4-yl]-(5-methyl-2H-pyrazol-3-yl)-amine

المذيبات

ظروف التفاعل

درجة الحرارة
90°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةcooled to room temperature
  2. 2
    ترشيحfiltered through a pad of celite
  3. 3
    غسيلThe pad is washed with methanol
  4. 4
    تركيزthe combined filtrate is concentrated in vacuo
  5. 5
    أخرىThe residue is purified by flash chromatography (SiO2, DCM/MeOH gradient)

الإجراء التجريبي

[2-(4-Acetamido-phenylsulfanyl)-7-nitroquinazolin-4-yl]-(5-methyl-2H-pyrazol-3-yl)-amine (182 mg, 4.18.10−4 mol) is dissolved in a mixture EtOH/water/AcOH(25/10/1, 36 mL) and the reaction is heated at 90° C. Iron powder (93 mg) is added and the mixture is stirred at 90° C. for 4 hours, cooled to room temperature and filtered through a pad of celite. The pad is washed with methanol and the combined filtrate is concentrated in vacuo. The residue is purified by flash chromatography (SiO2, DCM/MeOH gradient) to give the desired [2-(4-acetamido-phenylsulfanyl)-7-aminoquinazolin-4-yl]-(5-methyl-2H-pyrazol-3-yl)-amine.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07087603B2uspto-grants-2006_08