تفاعل #7306

ord-aa9d08d4a8be45e7b7b7d7d151edf62c

معادلة التفاعل

COC(=O)N[C@@H]1CNCC[C@@H]1C
cis-(4-methyl-piperidin-3-yl)-carbamic acid methyl ester
O=Cc1ccccc1
benzaldehyde
CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+]
sodium triacetoxyborohydride
COC(=O)N[C@@H]1CN(Cc2ccccc2)CC[C@@H]1C
Cis-(1-Benzyl-4-methyl-piperidin-3-yl)-carbamic acid methyl ester
المردود 70.0%

المذيبات

ظروف التفاعل

درجة الحرارة
20°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىto exotherm to 30°-35° C
  2. 2
    أخرىThe reaction was quenched with 78 ml saturated sodium bicarbonate (20 volumes)
  3. 3
    استخلاصextracted into 78 ml methylene chloride (20 volumes)
  4. 4
    تركيزconcentrated to a clear oil

الإجراء التجريبي

The reductive amination of cis-(4-methyl-piperidin-3-yl)-carbamic acid methyl ester was carried out by charging 3.9 grams (1 equiv., 22.6 mmol) to 2.07 ml benzaldehyde (0.9 equiv., 20.4 mmol), 9.6 grams sodium triacetoxyborohydride (2 equivs., 45.3 mmol) and 39 ml methylene chloride (10 volumes). The reaction was stirred at 20° C. and was allowed to exotherm to 30°-35° C. The reaction was complete by GCMS within 30 minutes. The reaction was quenched with 78 ml saturated sodium bicarbonate (20 volumes), extracted into 78 ml methylene chloride (20 volumes) and concentrated to a clear oil. (70% yield). 1H NMR: δ7.2-7.3 (5 H, m, aromatic protons), 5.50-5.48 (1 H, d, J=8.8 Hz), 3.77-3.75 (1 H, d, J=8.0 Hz), 3.63 (3 H, s), 3.45-3.38 (2 H, m), 2.77-2.74 (2 H, d, J=11.2 Hz), 2.14-2.01 (1 H, m), 1.94-1.89 (1 H, m), 1.57-1.55 (1 H, brs), 1.37-1.20 (2 H, m), 0.876 (3 H, d, J=9.2 Hz).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07084277B2uspto-grants-2006_08