تفاعل #710502

ord-9fc429338ce347968b5967a371c4bc46

معادلة التفاعل

[BH4-].[Na+]
NaBH4
FB(F)F
BF3
O=[N+]([O-])/C=C/c1ccc(C(F)(F)F)nc1Cl
2-Chloro-3-[(E)-2-nitrovinyl]-6-(trifluoromethyl)pyridine
Cl
hydrochloride
المردود 58.3%
NCCc1ccc(C(F)(F)F)nc1Cl
2-[2-chloro-6-(trifluoromethyl)pyridin-3-yl]ethanamine

ظروف التفاعل

درجة الحرارة
70°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe resulting reaction mixture
  2. 2
    أخرىwas allowed to room temperature
  3. 3
    workup.ADDITIONwas added to above reaction mixture at room temperature
  4. 4
    أخرىThe resulting reaction mixture
  5. 5
    أخرىwas allowed to room temperature
  6. 6
    workup.STIRRINGstirred for 16 h
  7. 7
    أخرىAfter completion of reaction
  8. 8
    أخرىthe reaction mixture was quenched in ice water (200 mL)
  9. 9
    استخلاصextracted with ethyl acetate (3×200 mL)
  10. 10
    غسيلThe combined organic layers were washed with water (1×100 mL), brine (1×100 mL)
  11. 11
    تجفيفdried over anhydrous sodium sulfate
  12. 12
    أخرىthe solvent was removed under reduced pressure
  13. 13
    أخرىto get crude amine
  14. 14
    workup.STIRRINGstirred at room temperature for 2.0 h
  15. 15
    تركيزThe reaction mixture was concentrated under reduced pressure

الإجراء التجريبي

To a stirred solution of NaBH4 (16.0 g, 4.2 eq.) in tetrahydrofuran (125 mL) was added BF3 etherate (125 mL) at 0° C. The resulting reaction mixture was allowed to room temperature and stirred for 15 min 2-Chloro-3-[(E)-2-nitrovinyl]-6-(trifluoromethyl)pyridine (Int-19) (25.0 g, 1.0 eq) in tetrahydrofuran (125 mL) was added to above reaction mixture at room temperature. The reaction mixture was heated to 70° C. and stirred for 2 h. The resulting reaction mixture was allowed to room temperature and stirred for 16 h. The progress of the reaction was monitored by TLC. After completion of reaction, the reaction mixture was quenched in ice water (200 mL) and extracted with ethyl acetate (3×200 mL). The combined organic layers were washed with water (1×100 mL), brine (1×100 mL), dried over anhydrous sodium sulfate and the solvent was removed under reduced pressure to get crude amine. The amine compound was dissolved in ethanolic HCl (50 mL) and stirred at room temperature for 2.0 h. The reaction mixture was concentrated under reduced pressure to get crude 2-[2-chloro-6-(trifluoromethyl)pyridin-3-yl]ethanamine (IIb-35) hydrochloride (15.0 g, 58.3%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09301526B2uspto-grants-2016_04