تفاعل #710500

ord-fd095199b01843ab9f17da757d74d52c

معادلة التفاعل

O=Cc1ccc(C(F)(F)F)nc1Cl
2-chloro-6-(trifluoromethyl)nicotinaldehyde
[Na+].[OH-]
sodium hydroxide
C[N+](=O)[O-]
nitro methane
O=[N+]([O-])CC(O)c1ccc(C(F)(F)F)nc1Cl
1-[2-chloro-6-(trifluoromethyl)pyridin-3-yl]-2-nitroethanol
المردود 72.0%

ظروف التفاعل

درجة الحرارة
100°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe resulting reaction mixture
  2. 2
    أخرىAfter completion of reaction
  3. 3
    تركيزthe reaction mixture was concentrated under reduced pressure
  4. 4
    أخرىto remove nitro methane
  5. 5
    أخرىquenched with ice water (500 mL)
  6. 6
    استخلاصextracted with ethyl acetate (2×1.0 L)
  7. 7
    غسيلThe combined organic layer was washed with water (500 mL), brine (500 mL)
  8. 8
    تجفيفdried over anhydrous sodium sulfate
  9. 9
    تركيزconcentrated under reduced pressure

الإجراء التجريبي

To a stirred solution of 2-chloro-6-(trifluoromethyl)nicotinaldehyde (Int-17) (70 g, 1.0 eq.) in nitro methane (700 mL) was added sodium hydroxide (6.7 g, 0.5 eq.) at room temperature. The resulting reaction mixture was heated to 100° C. and stirred for 2 h. The progress of the reaction was monitored by TLC. After completion of reaction, the reaction mixture was concentrated under reduced pressure to remove nitro methane quenched with ice water (500 mL) and extracted with ethyl acetate (2×1.0 L). The combined organic layer was washed with water (500 mL), brine (500 mL), dried over anhydrous sodium sulfate and concentrated under reduced pressure to get pure 1-[2-chloro-6-(trifluoromethyl)pyridin-3-yl]-2-nitroethanol (Int-18) (65.0 g, 72.0%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09301526B2uspto-grants-2016_04