تفاعل #706354

معادلة التفاعل

ethyl 2-hydroxybenzoate

K2CO3

N-(3-chloropropyl)morpholine hydrochloride

→

ethyl 2-[3-(4-morpholinyl)propoxy]benzoate

المذيبات

DMF

ظروف التفاعل

المعالجة

1. 1
   درجة الحرارةwas warmed on a steam bath overnight
2. 2
   درجة الحرارةThe reaction mixture was cooled
3. 3
   ترشيحfiltered
4. 4
   أخرىto afford a liquid which
5. 5
   أخرىwas partitioned between EtOAc (350 ml) and water
6. 6
   أخرىThe organic layer was separated
7. 7
   غسيلwashed with water (2×200 ml)
8. 8
   تجفيفdried over MgSO4

الإجراء التجريبي

To a mixture of ethyl 2-hydroxybenzoate (2.4 ml, 16.38 mmol), K2CO3 (4.98 g), and DMF (30 ml) was added N-(3-chloropropyl)morpholine hydrochloride (3.93 g). The mixture was stirred at room temperature for 30 minutes, then was warmed on a steam bath overnight. The reaction mixture was cooled, filtered and stripped to afford a liquid which was partitioned between EtOAc (350 ml) and water. The organic layer was separated, washed with water (2×200 ml), dried over MgSO4 and stripped to afford ethyl 2-[3-(4-morpholinyl)propoxy]benzoate.

المصدر