تفاعل #67885

ord-d01713c474f74d42b87c525175407e98

معادلة التفاعل

COc1ccccc1Br
2-bromoanisole
O=C([O-])[O-].[Cs+].[Cs+]
cesium carbonate
COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
2-dicyclohexylphosphino-2′,6′-dimethoxybiphenyl
NN.O
hydrazine hydrate
COc1cccc(OC)c1-c1ccccc1P(=O)(C1CCCCC1)C1CCCCC1
2′-(dicyclohexyl-phosphinoyl)-2,6-dimethoxy-biphenyl
المردود 45.4%

ظروف التفاعل

درجة الحرارة
95°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONwere added
  2. 2
    أخرىthe obtained reaction mixture
  3. 3
    درجة الحرارةThe reaction mixture was cooled to room temperature
  4. 4
    درجة الحرارةby heating
  5. 5
    درجة الحرارةto reflux for 1 hour
  6. 6
    درجة الحرارةThe reaction mixture was cooled to room temperature
  7. 7
    ترشيحfollowed by filtration with celite
  8. 8
    أخرىThe organic layer of the filtrate was separated
  9. 9
    غسيلwashed with saline
  10. 10
    أخرىThe solvents were evaporated under reduced pressure from the organic layer
  11. 11
    أخرىthe obtained residue was purified with NH-silica gel column chromatography (heptane:ethyl acetate=1:4)

الإجراء التجريبي

To the mixture of 2-bromoanisole (0.020 ml, 0.16 mmol) and 1,4-dioxane (2 ml), water (0.2 ml), cesium carbonate (0.32 g, 0.97 mmol), sodium 1,3-dioxo-1,3-dihydro-isoindole-2-ylmethyl trifluoroborate (81 mg, 0.32 mmol), palladium(II) acetate (3.6 mg, 0.016 mmol), and 2-dicyclohexylphosphino-2′,6′-dimethoxybiphenyl (13 mg, 0.032 mmol) were added, and then the obtained reaction mixture was stirred at 95° C. (an outer temperature) overnight. The reaction mixture was cooled to room temperature, and then hydrazine hydrate (0.039 ml, 0.81 mmol) and methanol (2 ml) were added thereto, followed by heating to reflux for 1 hour. The reaction mixture was cooled to room temperature, and then water and ethyl acetate were added to the reaction mixture, followed by filtration with celite. The organic layer of the filtrate was separated and washed with saline. The solvents were evaporated under reduced pressure from the organic layer, and then the obtained residue was purified with NH-silica gel column chromatography (heptane:ethyl acetate=1:4), thereby obtaining the entitled compound (4.1 mg, 19%) as the mixture with 2′-(dicyclohexyl-phosphinoyl)-2,6-dimethoxy-biphenyl (6.2 mg).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08524946B2uspto-grants-2013_09