تفاعل #62029

ord-24e99dd36e744b68b468b1ad859604b1

معادلة التفاعل

O=C(N[C@H]1CN2CCC1CC2)c1nsc2ccc(Br)cc12
N-((3R)-1-azabicyclo[2.2.2]oct-3-yl)-5-(bromo)benzo[d]isothiazole-3-carboxamide
O=C([O-])O.[Cs+]
caesium bicarbonate
CN(C)c1ccccc1-c1ccccc1P(C1CCCCC1)C1CCCCC1
(2′-dicyclohexylphosphanylbiphenyl-2-yl)dimethylamine
O=C(N[C@H]1CN2CCC1CC2)c1nsc2cc(N3CCOCC3)ccc12
6-morpholin-4-ylbenzo[d]isothiazole-3-carboxylic acid ((3R)-1-azabicyclo[2.2.2]oct-3-yl)amide
المردود 180.3%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe vial was then evacuated
  2. 2
    workup.ADDITIONback-filled with argon gas
  3. 3
    workup.ADDITIONThe mixture of solids
  4. 4
    workup.ADDITIONwas then diluted with morpholine (0.7 mL), dioxane (1 mL), and triethylamine (0.5 mL)
  5. 5
    أخرىthe reaction vessel was sealed
  6. 6
    أخرىirradiation at 120° C. for 1800 s
  7. 7
    ترشيحThe reaction mixture was filtered through a plug of celite and
  8. 8
    تركيزconcentrated in vacuo
  9. 9
    أخرىThe crude product was purified by chromatography (90/10/1 dichloromethane/methanol/ammonium hydroxide)

الإجراء التجريبي

In a 5 mL microwave reaction vessel was added N-((3R)-1-azabicyclo[2.2.2]oct-3-yl)-5-(bromo)benzo[d]isothiazole-3-carboxamide (133 mg, 0.37 mmol), tris(dibenzylideneacetone)dipalladium (0) (34 mg, 0.04 mmol), caesium bicarbonate (213 mg, 1.1 mmol), and (2′-dicyclohexylphosphanylbiphenyl-2-yl)dimethylamine (30 mg, 0.07 mmol). The vial was then evacuated and back-filled with argon gas. The mixture of solids was then diluted with morpholine (0.7 mL), dioxane (1 mL), and triethylamine (0.5 mL) and the reaction vessel was sealed. The reaction mixture was subjected to microwave irradiation at 120° C. for 1800 s. The reaction mixture was filtered through a plug of celite and concentrated in vacuo. The crude product was purified by chromatography (90/10/1 dichloromethane/methanol/ammonium hydroxide) to provide 47 mg (34%) of 6-morpholin-4-ylbenzo[d]isothiazole-3-carboxylic acid ((3R)-1-azabicyclo[2.2.2]oct-3-yl)amide as a colorless solid.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07429664B2uspto-grants-2008_09