تفاعل #619117

ord-f9113b5512f148d48ddaeec6a083998c

معادلة التفاعل

CCOC(=O)C=Cc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1
3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-acrylic acid ethyl ester
CCOC(=O)CCc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1
3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-propionic acid ethyl ester
المردود 47.7%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe content was degassed
  2. 2
    ترشيحThe mixture was filtered through celite
  3. 3
    تركيزthe filtrate was concentrated
  4. 4
    أخرىThe residue was further purified by flash chromatography (silica, CH2Cl2-EtOAc 4:1

الإجراء التجريبي

To a solution of 3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-acrylic acid ethyl ester (Example 257) (75 mg, 0.18 mmol) in methanol was added Pd/C (150 mg). The content was degassed and was placed under hydrogen atmosphere for 12 h. The mixture was filtered through celite, and the filtrate was concentrated. The residue was further purified by flash chromatography (silica, CH2Cl2-EtOAc 4:1 to give 3-[2-(3,3-dicyclohexylureido)-thiazol-5-yl]-propionic acid ethyl ester (35 mg) in 47% yield.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: USRE045183E1uspto-grants-2014_10